Difference between revisions of "3-CARBOXY-3-HYDROXY-ISOCAPROATE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008842001_1 == * Synonym(s): == Reactions associated == * RXN-12726 ** pantograph-a.taliana * SULFOCYS-RXN ** pantograph-...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CARBOXY-3-HYDROXY-ISOCAPROATE 3-CARBOXY-3-HYDROXY-ISOCAPROATE] == |
+ | * smiles: | ||
+ | ** CC(C)C(O)(CC(=O)[O-])C([O-])=O | ||
+ | * molecular weight: | ||
+ | ** 174.153 | ||
+ | * inchi key: | ||
+ | ** InChIKey=BITYXLXUCSKTJS-ZETCQYMHSA-L | ||
+ | * common name: | ||
+ | ** (2S)-2-isopropylmalate | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-hydroxy-4-methyl-3-carboxypentanoate | ||
+ | ** 3-carboxy-3-hydroxy-4-methylpentanoate | ||
+ | ** 3-carboxy-3-hydroxy-isocaproate | ||
+ | ** α-isopropylmalate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[2-ISOPROPYLMALATESYN-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-13163]] | |
− | + | * [[3-ISOPROPYLMALISOM-RXN]] | |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * BIGG : 3c3hmp |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02504 C02504] | ||
+ | * HMDB : HMDB00402 | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4925359.html 4925359] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1178 1178] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6419726 6419726] | ||
+ | {{#set: smiles=CC(C)C(O)(CC(=O)[O-])C([O-])=O}} | ||
+ | {{#set: molecular weight=174.153 }} | ||
+ | {{#set: inchi key=InChIKey=BITYXLXUCSKTJS-ZETCQYMHSA-L}} | ||
+ | {{#set: common name=(2S)-2-isopropylmalate}} | ||
+ | {{#set: common name=3-hydroxy-4-methyl-3-carboxypentanoate|3-carboxy-3-hydroxy-4-methylpentanoate|3-carboxy-3-hydroxy-isocaproate|α-isopropylmalate}} | ||
+ | {{#set: produced by=2-ISOPROPYLMALATESYN-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-13163|3-ISOPROPYLMALISOM-RXN}} |
Latest revision as of 17:24, 9 January 2019
Contents
Metabolite 3-CARBOXY-3-HYDROXY-ISOCAPROATE
- smiles:
- CC(C)C(O)(CC(=O)[O-])C([O-])=O
- molecular weight:
- 174.153
- inchi key:
- InChIKey=BITYXLXUCSKTJS-ZETCQYMHSA-L
- common name:
- (2S)-2-isopropylmalate
- Synonym(s):
- 3-hydroxy-4-methyl-3-carboxypentanoate
- 3-carboxy-3-hydroxy-4-methylpentanoate
- 3-carboxy-3-hydroxy-isocaproate
- α-isopropylmalate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(O)(CC(=O)[O-])C([O-])=O" cannot be used as a page name in this wiki.