Difference between revisions of "CPD-7695"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LysW-L-ornithine LysW-L-ornithine] == * common name: ** an [L-2-aminoadipate carrier protein]-L...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7695 CPD-7695] == |
| + | * smiles: | ||
| + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC2(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)NC(C)C([O-])=O)=O)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(CO)O2))([O-])=O)C)C)C)C)C)C)C | ||
| + | * molecular weight: | ||
| + | ** 1873.228 | ||
| + | * inchi key: | ||
| + | ** InChIKey=ULXTYUPMJXVUHQ-OVTFQNCVSA-K | ||
* common name: | * common name: | ||
| − | ** | + | ** ditrans,octacis-undecaprenyldiphospho-N-acetyl-(N-acetyl-β-D-glucosaminyl)muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanyl-D-alanine |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** lipid II |
| − | ** | + | ** undecaprenyl-pyrophosphoryl-MurNAc-(pentapeptide)-N-acetyl-β-D-glucosamine |
| + | ** undecaprenoldiphospho-β-D-GlcNAc-(1->4)-MurNAc(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala-D-Ala)- | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-8976]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878551 46878551] |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05889 C05889] | ||
| + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC2(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)NC(C)C([O-])=O)=O)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(CO)O2))([O-])=O)C)C)C)C)C)C)C}} | ||
| + | {{#set: molecular weight=1873.228 }} | ||
| + | {{#set: inchi key=InChIKey=ULXTYUPMJXVUHQ-OVTFQNCVSA-K}} | ||
| + | {{#set: common name=ditrans,octacis-undecaprenyldiphospho-N-acetyl-(N-acetyl-β-D-glucosaminyl)muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanyl-D-alanine}} | ||
| + | {{#set: common name=lipid II|undecaprenyl-pyrophosphoryl-MurNAc-(pentapeptide)-N-acetyl-β-D-glucosamine|undecaprenoldiphospho-β-D-GlcNAc-(1->4)-MurNAc(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala-D-Ala)-}} | ||
| + | {{#set: produced by=RXN-8976}} | ||
Latest revision as of 16:24, 9 January 2019
Contents
Metabolite CPD-7695
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC2(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)NC(C)C([O-])=O)=O)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(CO)O2))([O-])=O)C)C)C)C)C)C)C
- molecular weight:
- 1873.228
- inchi key:
- InChIKey=ULXTYUPMJXVUHQ-OVTFQNCVSA-K
- common name:
- ditrans,octacis-undecaprenyldiphospho-N-acetyl-(N-acetyl-β-D-glucosaminyl)muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanyl-D-alanine
- Synonym(s):
- lipid II
- undecaprenyl-pyrophosphoryl-MurNAc-(pentapeptide)-N-acetyl-β-D-glucosamine
- undecaprenoldiphospho-β-D-GlcNAc-(1->4)-MurNAc(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala-D-Ala)-
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC2(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)NC(C)C([O-])=O)=O)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(CO)O2))([O-])=O)C)C)C)C)C)C)C" cannot be used as a page name in this wiki.
"undecaprenoldiphospho-β-D-GlcNAc-(1->4)-MurNAc(oyl-L-Ala-γ-D-Glu-L-Lys-D-Ala-D-Ala)-" cannot be used as a page name in this wiki.
