Difference between revisions of "GLYCOGENSYN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYURIDINE DEOXYURIDINE] == * smiles: ** C1(=CN(C(=O)NC(=O)1)C2(CC(O)C(CO)O2)) * inchi key: *...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCOGENSYN-RXN GLYCOGENSYN-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Starch synthase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.1.21 EC-2.4.1.21] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[ADP-D-GLUCOSE]][c] '''+''' 1 [[1-4-alpha-D-Glucan]][c] '''<=>''' 1 [[1-4-alpha-D-Glucan]][c] '''+''' 1 [[ADP]][c] |
− | == | + | * With common name(s): |
+ | ** 1 ADP-α-D-glucose[c] '''+''' 1 a 1,4-α-D-glucan[c] '''<=>''' 1 a 1,4-α-D-glucan[c] '''+''' 1 ADP[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00009277001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00009277001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[GLYCOGENSYNTH-PWY]], glycogen biosynthesis I (from ADP-D-Glucose): [http://metacyc.org/META/NEW-IMAGE?object=GLYCOGENSYNTH-PWY GLYCOGENSYNTH-PWY] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-622]], starch biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-622 PWY-622] | ||
+ | ** '''8''' reactions found over '''10''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02421 R02421] |
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P45179 P45179] |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/Q40739 Q40739] |
− | * | + | ** [http://www.uniprot.org/uniprot/P39125 P39125] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q43784 Q43784] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P72623 P72623] |
− | * | + | ** [http://www.uniprot.org/uniprot/P0A6U8 P0A6U8] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/O48899 O48899] |
− | * | + | ** [http://www.uniprot.org/uniprot/O48900 O48900] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/O49064 O49064] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q43654 Q43654] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P93568 P93568] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O48515 O48515] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O48516 O48516] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O64925 O64925] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q42857 Q42857] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q00775 Q00775] |
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: common name=Starch synthase}} | ||
+ | {{#set: ec number=EC-2.4.1.21}} | ||
+ | {{#set: gene associated=CHC_T00009277001_1|CHC_T00009277001}} | ||
+ | {{#set: in pathway=GLYCOGENSYNTH-PWY|PWY-622}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 16:22, 9 January 2019
Contents
Reaction GLYCOGENSYN-RXN
- direction:
- REVERSIBLE
- common name:
- Starch synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ADP-D-GLUCOSE[c] + 1 1-4-alpha-D-Glucan[c] <=> 1 1-4-alpha-D-Glucan[c] + 1 ADP[c]
- With common name(s):
- 1 ADP-α-D-glucose[c] + 1 a 1,4-α-D-glucan[c] <=> 1 a 1,4-α-D-glucan[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00009277001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00009277001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
Pathways
- GLYCOGENSYNTH-PWY, glycogen biosynthesis I (from ADP-D-Glucose): GLYCOGENSYNTH-PWY
- 4 reactions found over 4 reactions in the full pathway
- PWY-622, starch biosynthesis: PWY-622
- 8 reactions found over 10 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome
External links
- LIGAND-RXN:
- UNIPROT: