Difference between revisions of "3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00006864001_1 == * Synonym(s): == Reactions associated == * DNA-DIRECTED-RNA-POLYMERASE-RXN ** pantograph-galdieria.sulphuraria ==...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN 3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN] == |
+ | * smiles: | ||
+ | ** CC(CC(C1(C(=CC(=CC=1O)O)O))=O)C | ||
+ | * molecular weight: | ||
+ | ** 210.229 | ||
+ | * inchi key: | ||
+ | ** InChIKey=VSDWHZGJGWMIRN-UHFFFAOYSA-N | ||
+ | * common name: | ||
+ | ** phlorisovalerophenone | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-methyl-1-(2,4,6-trihydroxyphenyl)butan-1-one | ||
+ | ** PIVP | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-7811]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15951 15951] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=441269 441269] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C07350 C07350] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.390036.html 390036] | ||
+ | * HMDB : HMDB33798 | ||
+ | {{#set: smiles=CC(CC(C1(C(=CC(=CC=1O)O)O))=O)C}} | ||
+ | {{#set: molecular weight=210.229 }} | ||
+ | {{#set: inchi key=InChIKey=VSDWHZGJGWMIRN-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=phlorisovalerophenone}} | ||
+ | {{#set: common name=3-methyl-1-(2,4,6-trihydroxyphenyl)butan-1-one|PIVP}} | ||
+ | {{#set: consumed by=RXN-7811}} |
Latest revision as of 16:27, 9 January 2019
Contents
Metabolite 3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN
- smiles:
- CC(CC(C1(C(=CC(=CC=1O)O)O))=O)C
- molecular weight:
- 210.229
- inchi key:
- InChIKey=VSDWHZGJGWMIRN-UHFFFAOYSA-N
- common name:
- phlorisovalerophenone
- Synonym(s):
- 3-methyl-1-(2,4,6-trihydroxyphenyl)butan-1-one
- PIVP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links