Difference between revisions of "CANAVANINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9549 RXN-9549] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3....")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9549 RXN-9549] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(CC([N+])C(=O)[O-])ONC(=[N+])N
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.1.2.14 EC-3.1.2.14]
+
** 177.183   
 +
* inchi key:
 +
** InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O
 +
* common name:
 +
** L-canavanine
 
* Synonym(s):
 
* Synonym(s):
 +
** canavanine
 +
** 2-amino-4-(guanidinooxy)butyrate
 +
** 2-amino-4-(guanidinooxy)butyric acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[WATER]][c] '''+''' 1 [[Palmitoyl-ACPs]][c] '''=>''' 1 [[PALMITATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ACP]][c]
+
* [[RXN-22]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H2O[c] '''+''' 1 a palmitoyl-[acp][c] '''=>''' 1 palmitate[c] '''+''' 1 H+[c] '''+''' 1 a holo-[acyl-carrier protein][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7746]], mycobacterial sulfolipid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7746 PWY-7746]
+
−
** '''1''' reactions found over '''8''' reactions in the full pathway
+
−
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
+
−
** '''31''' reactions found over '''31''' reactions in the full pathway
+
−
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
+
−
** '''22''' reactions found over '''31''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[gap-filling]]:
+
−
** [[meneco]]:
+
−
*** [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CHEBI:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30130 30130]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78902 78902]
−
* LIGAND-RXN:
+
* CAS : 543-38-4
−
** [http://www.genome.jp/dbget-bin/www_bget?R01706 R01706]
+
* PUBCHEM:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688185 36688185]
−
{{#set: ec number=EC-3.1.2.14}}
+
* LIGAND-CPD:
−
{{#set: in pathway=PWY-7746|PWY-5971|PWY-5994}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00308 C00308]
−
{{#set: reconstruction category=gap-filling}}
+
* HMDB : HMDB02706
−
{{#set: reconstruction tool=meneco}}
+
{{#set: smiles=C(CC([N+])C(=O)[O-])ONC(=[N+])N}}
−
{{#set: reconstruction source=added for gapfilling}}
+
{{#set: molecular weight=177.183    }}
 +
{{#set: inchi key=InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O}}
 +
{{#set: common name=L-canavanine}}
 +
{{#set: common name=canavanine|2-amino-4-(guanidinooxy)butyrate|2-amino-4-(guanidinooxy)butyric acid}}
 +
{{#set: produced by=RXN-22}}

Latest revision as of 15:04, 9 January 2019

Metabolite CANAVANINE

  • smiles:
    • C(CC([N+])C(=O)[O-])ONC(=[N+])N
  • molecular weight:
    • 177.183
  • inchi key:
    • InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O
  • common name:
    • L-canavanine
  • Synonym(s):
    • canavanine
    • 2-amino-4-(guanidinooxy)butyrate
    • 2-amino-4-(guanidinooxy)butyric acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(CC([N+])C(=O)[O-])ONC(=[N+])N" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CANAVANINE&oldid=19781"