Difference between revisions of "CPD-8618"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14199 RXN-14199] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14199 RXN-14199] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8618 CPD-8618] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C([CH]=O)C(O)CC3)))CC4)))C
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.6.1.5 EC-3.6.1.5]
+
** 414.67   
 +
* inchi key:
 +
** InChIKey=MHYWFGFPMGLYBL-NUESBDPTSA-N
 +
* common name:
 +
** 4α-formyl-5α-cholesta-8-en-3β-ol
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-22]]
−
** 1 [[DUTP]][c] '''+''' 2 [[WATER]][c] '''=>''' 2 [[PROTON]][c] '''+''' 2 [[Pi]][c] '''+''' 1 [[DUMP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN66-21]]
−
** 1 dUTP[c] '''+''' 2 H2O[c] '''=>''' 2 H+[c] '''+''' 2 phosphate[c] '''+''' 1 dUMP[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00001236001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: ec number=EC-3.6.1.5}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87054 87054]
−
{{#set: gene associated=CHC_T00001236001_1}}
+
* PUBCHEM:
−
{{#set: in pathway=}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263320 44263320]
−
{{#set: reconstruction category=orthology}}
+
* HMDB : HMDB12169
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C([CH]=O)C(O)CC3)))CC4)))C}}
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: molecular weight=414.67    }}
 +
{{#set: inchi key=InChIKey=MHYWFGFPMGLYBL-NUESBDPTSA-N}}
 +
{{#set: common name=4α-formyl-5α-cholesta-8-en-3β-ol}}
 +
{{#set: consumed by=RXN66-22}}
 +
{{#set: produced by=RXN66-21}}

Latest revision as of 16:29, 9 January 2019

Metabolite CPD-8618

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C([CH]=O)C(O)CC3)))CC4)))C
  • molecular weight:
    • 414.67
  • inchi key:
    • InChIKey=MHYWFGFPMGLYBL-NUESBDPTSA-N
  • common name:
    • 4α-formyl-5α-cholesta-8-en-3β-ol
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C([CH]=O)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-8618&oldid=21825"