Difference between revisions of "LIPOYL-AMP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=TRPCAT-PWY TRPCAT-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=TRPCAT-PWY TRPCAT-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOYL-AMP LIPOYL-AMP] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O)
 +
* molecular weight:
 +
** 534.518   
 +
* inchi key:
 +
** InChIKey=QWEGOCJRZOKSOE-ADUAKINBSA-M
 
* common name:
 
* common name:
** L-tryptophan degradation I (via anthranilate)
+
** lipoyl-adenylate
 
* Synonym(s):
 
* Synonym(s):
** anthranilate pathway
+
** lipoyl-AMP
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''2''' reaction(s) found
+
* [[RXN-13039]]
** [[KYNURENINASE-RXN]]
+
* [[RXN-8655]]
** [[RXN-8665]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) not found ==
+
* [[RXN-8654]]
* '''1''' reaction(s) not found
+
== Reaction(s) of unknown directionality ==
** [http://metacyc.org/META/NEW-IMAGE?object=ARYLFORMAMIDASE-RXN ARYLFORMAMIDASE-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2}}
+
* CHEBI:
{{#set: common name=L-tryptophan degradation I (via anthranilate)}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83091 83091]
{{#set: common name=anthranilate pathway}}
+
* PUBCHEM:
{{#set: reaction found=2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245420 25245420]
{{#set: reaction not found=1}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C16238 C16238]
 +
* HMDB : HMDB59635
 +
{{#set: smiles=C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O)}}
 +
{{#set: molecular weight=534.518    }}
 +
{{#set: inchi key=InChIKey=QWEGOCJRZOKSOE-ADUAKINBSA-M}}
 +
{{#set: common name=lipoyl-adenylate}}
 +
{{#set: common name=lipoyl-AMP}}
 +
{{#set: consumed by=RXN-13039|RXN-8655}}
 +
{{#set: produced by=RXN-8654}}

Latest revision as of 15:04, 9 January 2019

Metabolite LIPOYL-AMP

  • smiles:
    • C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O)
  • molecular weight:
    • 534.518
  • inchi key:
    • InChIKey=QWEGOCJRZOKSOE-ADUAKINBSA-M
  • common name:
    • lipoyl-adenylate
  • Synonym(s):
    • lipoyl-AMP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O)" cannot be used as a page name in this wiki.