Difference between revisions of "DUTP"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6019 PWY-6019] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O |
− | ** | + | * molecular weight: |
+ | ** 464.112 | ||
+ | * inchi key: | ||
+ | ** InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** dUTP |
* Synonym(s): | * Synonym(s): | ||
+ | ** deoxy-UTP | ||
+ | ** 2'-deoxyuridine-5'-triphosphate | ||
+ | ** deoxyuridine-triphosphate | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[DUTP-PYROP-RXN]] |
− | ** [[ | + | * [[RXN-14219]] |
− | == Reaction(s) | + | * [[RXN-14199]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[DUDPKIN-RXN]] | |
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * BIGG : dutp |
− | ** [http:// | + | * CAS : 1173-82-6 |
− | {{#set: | + | * HMDB : HMDB01191 |
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61555 61555] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00460 C00460] |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244408 25244408] | ||
+ | {{#set: smiles=C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}} | ||
+ | {{#set: molecular weight=464.112 }} | ||
+ | {{#set: inchi key=InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J}} | ||
+ | {{#set: common name=dUTP}} | ||
+ | {{#set: common name=deoxy-UTP|2'-deoxyuridine-5'-triphosphate|deoxyuridine-triphosphate}} | ||
+ | {{#set: consumed by=DUTP-PYROP-RXN|RXN-14219|RXN-14199}} | ||
+ | {{#set: produced by=DUDPKIN-RXN}} |
Latest revision as of 16:30, 9 January 2019
Contents
Metabolite DUTP
- smiles:
- C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
- molecular weight:
- 464.112
- inchi key:
- InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J
- common name:
- dUTP
- Synonym(s):
- deoxy-UTP
- 2'-deoxyuridine-5'-triphosphate
- deoxyuridine-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.