Difference between revisions of "RXN-14192"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O * inchi key: ** InChIKey=R...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14192 RXN-14192] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** pyruvate kinase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.7.1.40 EC-2.7.1.40] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[PYRUVATE]][c] '''+''' 1 [[DATP]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[DADP]][c] '''+''' 1 [[PHOSPHO-ENOL-PYRUVATE]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 pyruvate[c] '''+''' 1 dATP[c] '''<=>''' 1 H+[c] '''+''' 1 dADP[c] '''+''' 1 phosphoenolpyruvate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[CHC_T00008482001_1]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | * Gene: [[CHC_T00008652001_1]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | * Gene: [[CHC_T00008530001_1]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | * Gene: [[CHC_T00008530001]] | ||
| + | ** Source: [[annotation-original_genome]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | * Gene: [[CHC_T00008482001]] | ||
| + | ** Source: [[annotation-original_genome]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-original_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30730 30730] |
| − | * | + | * LIGAND-RXN: |
| − | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01138 R01138] |
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=pyruvate kinase}} | |
| − | + | {{#set: ec number=EC-2.7.1.40}} | |
| − | {{#set: | + | {{#set: gene associated=CHC_T00008482001_1|CHC_T00008652001_1|CHC_T00008530001_1|CHC_T00008530001|CHC_T00008482001}} |
| − | {{#set: | + | {{#set: in pathway=}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome|orthology-ectocarpus_siliculosus}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
| − | {{#set: | + | |
Latest revision as of 15:03, 9 January 2019
Contents
Reaction RXN-14192
- direction:
- REVERSIBLE
- common name:
- pyruvate kinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PYRUVATE[c] + 1 DATP[c] <=> 1 PROTON[c] + 1 DADP[c] + 1 PHOSPHO-ENOL-PYRUVATE[c]
- With common name(s):
- 1 pyruvate[c] + 1 dATP[c] <=> 1 H+[c] + 1 dADP[c] + 1 phosphoenolpyruvate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00008482001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00008652001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00008530001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00008530001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
- Gene: CHC_T00008482001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome
External links
