Difference between revisions of "CHC T00006291001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8618 CPD-8618] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C([CH]=O...")
 
(Created page with "Category:Gene == Gene CHC_T00006291001_1 == * Synonym(s): == Reactions associated == * Reaction: 3.4.24.56-RXN ** Source: orthology-galdieria.sulphuraria == Pathw...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8618 CPD-8618] ==
+
== Gene CHC_T00006291001_1 ==
* smiles:
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C([CH]=O)C(O)CC3)))CC4)))C
+
* inchi key:
+
** InChIKey=MHYWFGFPMGLYBL-NUESBDPTSA-N
+
* common name:
+
** 4α-formyl-5α-cholesta-8-en-3β-ol
+
* molecular weight:
+
** 414.67   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN66-22]]
+
* Reaction: [[3.4.24.56-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-galdieria.sulphuraria]]
* [[RXN66-21]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=3.4.24.56-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263320 44263320]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87054 87054]
+
* HMDB : HMDB12169
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C([CH]=O)C(O)CC3)))CC4)))C}}
+
{{#set: inchi key=InChIKey=MHYWFGFPMGLYBL-NUESBDPTSA-N}}
+
{{#set: common name=4α-formyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: molecular weight=414.67    }}
+
{{#set: consumed by=RXN66-22}}
+
{{#set: produced by=RXN66-21}}
+

Latest revision as of 15:48, 23 May 2018

Gene CHC_T00006291001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links