Difference between revisions of "RXN-1223"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1223 RXN-1223] ==
−
* smiles:
+
* direction:
−
** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J
+
** [http://enzyme.expasy.org/EC/3.13.1.1 EC-3.13.1.1]
−
* common name:
+
−
** phytenoyl-CoA
+
−
* molecular weight:
+
−
** 1056.006   
+
 
* Synonym(s):
 
* Synonym(s):
−
** E-phytenoyl-CoA
 
−
** trans-phytenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN66-482]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[SO3]][c] '''+''' 1 [[CPD-12575]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[UDP-SULFOQUINOVOSE]][c]
−
* [[RXN66-480]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H+[c] '''+''' 1 sulfite[c] '''+''' 1 UDP-α-D-glucose[c] '''=>''' 1 H2O[c] '''+''' 1 UDP-α-D-sulfoquinovopyranose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009188001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways  ==
 +
* [[PWYQT-4427]], sulfoquinovosyl diacylglycerol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4427 PWYQT-4427]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657969 90657969]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13197 13197]
−
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
* LIGAND-RXN:
−
{{#set: inchi key=InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R05775 R05775]
−
{{#set: common name=phytenoyl-CoA}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: molecular weight=1056.006    }}
+
{{#set: ec number=EC-3.13.1.1}}
−
{{#set: common name=E-phytenoyl-CoA|trans-phytenoyl-CoA}}
+
{{#set: gene associated=CHC_T00009188001_1}}
−
{{#set: consumed by=RXN66-482}}
+
{{#set: in pathway=PWYQT-4427}}
−
{{#set: produced by=RXN66-480}}
+
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-arabidopsis_thaliana|orthology-ectocarpus_siliculosus}}
 +
{{#set: reconstruction tool=pantograph}}

Latest revision as of 16:27, 9 January 2019

Reaction RXN-1223

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H+[c] + 1 sulfite[c] + 1 UDP-α-D-glucose[c] => 1 H2O[c] + 1 UDP-α-D-sulfoquinovopyranose[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYQT-4427, sulfoquinovosyl diacylglycerol biosynthesis: PWYQT-4427
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-1223&oldid=21768"