Difference between revisions of "PWY-7388"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C * inchi key...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7388 PWY-7388] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast) |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** octanoyl-ACP biosynthesis (mitochondria, yeast) | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''8''' reactions found over '''9''' reactions in the full pathway | |
− | * [[RXN- | + | * [[3-OXOACYL-ACP-SYNTH-BASE-RXN]] |
− | * [[ | + | ** 2 associated gene(s): |
− | * [[RXN- | + | *** [[CHC_T00009465001]] |
− | == Reaction(s) | + | *** [[CHC_T00009465001_1]] |
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[4.2.1.58-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00009190001_1]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | * [[ACETYL-COA-CARBOXYLTRANSFER-RXN]] | ||
+ | ** 8 associated gene(s): | ||
+ | *** [[CHC_T00009359001_1]] | ||
+ | *** [[CHC_640]] | ||
+ | *** [[CHC_T00009359001]] | ||
+ | *** [[CHC_T00008359001]] | ||
+ | *** [[CHC_T00009426001_1]] | ||
+ | *** [[CHC_T00008359001_1]] | ||
+ | *** [[CHC_T00007145001_1]] | ||
+ | *** [[CHC_55]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[MALONYL-COA-ACP-TRANSACYL-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00008765001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RXN-14972]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | * [[RXN-14973]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | * [[RXN-9514]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[CHC_T00008496001]] | ||
+ | *** [[CHC_T00008477001]] | ||
+ | *** [[CHC_T00008557001]] | ||
+ | *** [[CHC_T00008517001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RXN-9516]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00009465001_1]] | ||
+ | *** [[CHC_T00009465001]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9515 RXN-9515] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast)}} | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: common name=octanoyl-ACP biosynthesis (mitochondria, yeast)}} | |
− | + | {{#set: reaction found=8}} | |
− | + | {{#set: total reaction=9}} | |
− | + | {{#set: completion rate=89.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 17:22, 9 January 2019
Pathway PWY-7388
- common name:
- octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast)
- taxonomic range:
- Synonym(s):
- octanoyl-ACP biosynthesis (mitochondria, yeast)
Reaction(s) found
8 reactions found over 9 reactions in the full pathway
- 3-OXOACYL-ACP-SYNTH-BASE-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- 4.2.1.58-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- ACETYL-COA-CARBOXYLTRANSFER-RXN
- 8 associated gene(s):
- 4 reconstruction source(s) associated:
- MALONYL-COA-ACP-TRANSACYL-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-14972
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-14973
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-9514
- 4 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-9516
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
Reaction(s) not found
External links
"octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast)" cannot be used as a page name in this wiki.