Difference between revisions of "LEU"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009244001 == * left end position: ** 31897 * transcription direction: ** POSITIVE * right end position: ** 33297 * centisome position: ** 72.7...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU LEU] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(CC([N+])C([O-])=O)C |
| − | * | + | * molecular weight: |
| − | ** | + | ** 131.174 |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N |
| − | * | + | * common name: |
| − | ** | + | ** L-leucine |
* Synonym(s): | * Synonym(s): | ||
| + | ** (2S)-α-2-amino-4-methylvaleric acid | ||
| + | ** L | ||
| + | ** leu | ||
| + | ** leucine | ||
| + | ** 2-amino-4-methylvaleric acid | ||
| + | ** (2S)-α-leucine | ||
| + | ** L-leu | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[LEUCINE--TRNA-LIGASE-RXN]] |
| − | * | + | * [[biomass_rxn]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | == Reaction(s) of unknown directionality == |
| + | * [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]] | ||
| + | * [[LEUCINE-23-AMINOMUTASE-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * METABOLIGHTS : MTBLC57427 |
| − | {{#set: | + | * BIGG : leu__L |
| − | {{#set: | + | * CAS : 61-90-5 |
| − | {{#set: | + | * HMDB : HMDB00687 |
| − | {{#set: reaction associated= | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57427 57427] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00123 C00123] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7045798 7045798] | ||
| + | * NCI: | ||
| + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=46709 46709] | ||
| + | {{#set: smiles=CC(CC([N+])C([O-])=O)C}} | ||
| + | {{#set: molecular weight=131.174 }} | ||
| + | {{#set: inchi key=InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N}} | ||
| + | {{#set: common name=L-leucine}} | ||
| + | {{#set: common name=(2S)-α-2-amino-4-methylvaleric acid|L|leu|leucine|2-amino-4-methylvaleric acid|(2S)-α-leucine|L-leu}} | ||
| + | {{#set: consumed by=LEUCINE--TRNA-LIGASE-RXN|biomass_rxn}} | ||
| + | {{#set: reversible reaction associated=BRANCHED-CHAINAMINOTRANSFERLEU-RXN|LEUCINE-23-AMINOMUTASE-RXN}} | ||
Latest revision as of 17:32, 9 January 2019
Contents
Metabolite LEU
- smiles:
- CC(CC([N+])C([O-])=O)C
- molecular weight:
- 131.174
- inchi key:
- InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N
- common name:
- L-leucine
- Synonym(s):
- (2S)-α-2-amino-4-methylvaleric acid
- L
- leu
- leucine
- 2-amino-4-methylvaleric acid
- (2S)-α-leucine
- L-leu
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC57427
- BIGG : leu__L
- CAS : 61-90-5
- HMDB : HMDB00687
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
- NCI:
"CC(CC([N+])C([O-])=O)C" cannot be used as a page name in this wiki.
