Difference between revisions of "PWY-5751"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE L-ASPARTATE] == * smiles: ** C(C(=O)[O-])C([N+])C(=O)[O-] * inchi key: ** InChIKey=...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5751 PWY-5751] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** phenylethanol biosynthesis |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-131567 TAX-131567] | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** phenyacetaldehyde biosynthesis |
− | ** | + | ** phenylacetaldehyde and phenylethanol biosynthesis |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''1''' reactions found over '''5''' reactions in the full pathway |
− | * | + | * [[RXN-7700]] |
− | * | + | ** 1 associated gene(s): |
− | * | + | *** [[CHC_T00010066001_1]] |
− | * | + | ** 1 reconstruction source(s) associated: |
− | * [[ | + | *** [[orthology-galdieria.sulphuraria]] |
− | * | + | == Reaction(s) not found == |
− | * | + | * [http://metacyc.org/META/NEW-IMAGE?object=AMINEPHEN-RXN AMINEPHEN-RXN] |
− | + | * [http://metacyc.org/META/NEW-IMAGE?object=PHENYLALANINE-DECARBOXYLASE-RXN PHENYLALANINE-DECARBOXYLASE-RXN] | |
− | * [[ | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13536 RXN-13536] |
− | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8990 RXN-8990] | |
− | == Reaction(s) | + | |
− | * [ | + | |
− | * [ | + | |
− | * [ | + | |
− | * [ | + | |
== External links == | == External links == | ||
− | + | {{#set: common name=phenylethanol biosynthesis}} | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: taxonomic range=TAX-131567}} | |
− | + | {{#set: common name=phenyacetaldehyde biosynthesis|phenylacetaldehyde and phenylethanol biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=20.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 17:22, 9 January 2019
Pathway PWY-5751
- common name:
- phenylethanol biosynthesis
- taxonomic range:
- Synonym(s):
- phenyacetaldehyde biosynthesis
- phenylacetaldehyde and phenylethanol biosynthesis
Reaction(s) found
1 reactions found over 5 reactions in the full pathway
- RXN-7700
- 1 associated gene(s):
- 1 reconstruction source(s) associated: