Difference between revisions of "3.4.25.1-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) * i...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.25.1-RXN 3.4.25.1-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Proteasome subunit alpha type |
− | * | + | ** Proteasome subunit beta type |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/3.4.25.1 EC-3.4.25.1] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[General-Protein-Substrates]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Peptides-holder]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a protein[c] '''+''' 1 H2O[c] '''=>''' 1 a peptide[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00005811001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00008987001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00001498001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00008987001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[CHC_T00009012001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00005235001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00008356001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00008406001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00009346001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00009185001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00008941001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00009464001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00008527001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00009373001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00008406001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[CHC_T00009004001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00008367001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00005557001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00005533001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00005699001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00009544001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/Q7DLR9 Q7DLR9] |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P28062 P28062] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9TRJ7 Q9TRJ7] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P30656 P30656] |
− | * | + | ** [http://www.uniprot.org/uniprot/P30657 P30657] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P28074 P28074] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P40302 P40302] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O24633 O24633] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P40303 P40303] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9V122 Q9V122] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P40306 P40306] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P28063 P28063] |
+ | ** [http://www.uniprot.org/uniprot/P25786 P25786] | ||
+ | ** [http://www.uniprot.org/uniprot/P28076 P28076] | ||
+ | ** [http://www.uniprot.org/uniprot/O13268 O13268] | ||
+ | ** [http://www.uniprot.org/uniprot/P34064 P34064] | ||
+ | ** [http://www.uniprot.org/uniprot/P60901 P60901] | ||
+ | ** [http://www.uniprot.org/uniprot/P18421 P18421] | ||
+ | ** [http://www.uniprot.org/uniprot/P18053 P18053] | ||
+ | ** [http://www.uniprot.org/uniprot/P28072 P28072] | ||
+ | ** [http://www.uniprot.org/uniprot/P22769 P22769] | ||
+ | ** [http://www.uniprot.org/uniprot/P25043 P25043] | ||
+ | ** [http://www.uniprot.org/uniprot/P28065 P28065] | ||
+ | ** [http://www.uniprot.org/uniprot/P30186 P30186] | ||
+ | ** [http://www.uniprot.org/uniprot/P60900 P60900] | ||
+ | ** [http://www.uniprot.org/uniprot/P34065 P34065] | ||
+ | ** [http://www.uniprot.org/uniprot/P34067 P34067] | ||
+ | ** [http://www.uniprot.org/uniprot/P40301 P40301] | ||
+ | ** [http://www.uniprot.org/uniprot/Q8AVD2 Q8AVD2] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7LZF1 Q7LZF1] | ||
+ | ** [http://www.uniprot.org/uniprot/P40307 P40307] | ||
+ | ** [http://www.uniprot.org/uniprot/P23724 P23724] | ||
+ | ** [http://www.uniprot.org/uniprot/P28070 P28070] | ||
+ | ** [http://www.uniprot.org/uniprot/P22141 P22141] | ||
+ | ** [http://www.uniprot.org/uniprot/P49721 P49721] | ||
+ | ** [http://www.uniprot.org/uniprot/P49720 P49720] | ||
+ | ** [http://www.uniprot.org/uniprot/P25156 P25156] | ||
+ | ** [http://www.uniprot.org/uniprot/Q09682 Q09682] | ||
+ | ** [http://www.uniprot.org/uniprot/Q09720 Q09720] | ||
+ | ** [http://www.uniprot.org/uniprot/P48004 P48004] | ||
+ | ** [http://www.uniprot.org/uniprot/P38624 P38624] | ||
+ | ** [http://www.uniprot.org/uniprot/P32379 P32379] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7LZF0 Q7LZF0] | ||
+ | ** [http://www.uniprot.org/uniprot/P62333 P62333] | ||
+ | ** [http://www.uniprot.org/uniprot/Q24178 Q24178] | ||
+ | ** [http://www.uniprot.org/uniprot/Q27575 Q27575] | ||
+ | ** [http://www.uniprot.org/uniprot/P21242 P21242] | ||
+ | ** [http://www.uniprot.org/uniprot/P21243 P21243] | ||
+ | ** [http://www.uniprot.org/uniprot/P23638 P23638] | ||
+ | ** [http://www.uniprot.org/uniprot/P23639 P23639] | ||
+ | ** [http://www.uniprot.org/uniprot/P12881 P12881] | ||
+ | ** [http://www.uniprot.org/uniprot/P25787 P25787] | ||
+ | ** [http://www.uniprot.org/uniprot/P20618 P20618] | ||
+ | ** [http://www.uniprot.org/uniprot/P25788 P25788] | ||
+ | ** [http://www.uniprot.org/uniprot/P25789 P25789] | ||
+ | ** [http://www.uniprot.org/uniprot/P18420 P18420] | ||
+ | ** [http://www.uniprot.org/uniprot/P18422 P18422] | ||
+ | ** [http://www.uniprot.org/uniprot/P21670 P21670] | ||
+ | ** [http://www.uniprot.org/uniprot/P52428 P52428] | ||
+ | ** [http://www.uniprot.org/uniprot/P93395 P93395] | ||
+ | ** [http://www.uniprot.org/uniprot/O04861 O04861] | ||
+ | ** [http://www.uniprot.org/uniprot/Q8LD27 Q8LD27] | ||
+ | ** [http://www.uniprot.org/uniprot/O48551 O48551] | ||
+ | ** [http://www.uniprot.org/uniprot/O24030 O24030] | ||
+ | ** [http://www.uniprot.org/uniprot/P42742 P42742] | ||
+ | ** [http://www.uniprot.org/uniprot/O81147 O81147] | ||
+ | ** [http://www.uniprot.org/uniprot/O23708 O23708] | ||
+ | ** [http://www.uniprot.org/uniprot/O24616 O24616] | ||
+ | ** [http://www.uniprot.org/uniprot/O81149 O81149] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42134 Q42134] | ||
+ | ** [http://www.uniprot.org/uniprot/P34066 P34066] | ||
+ | ** [http://www.uniprot.org/uniprot/O23712 O23712] | ||
+ | ** [http://www.uniprot.org/uniprot/O23710 O23710] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7DLS1 Q7DLS1] | ||
+ | ** [http://www.uniprot.org/uniprot/O81153 O81153] | ||
+ | ** [http://www.uniprot.org/uniprot/O23714 O23714] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=Proteasome subunit alpha type}} | ||
+ | {{#set: common name=Proteasome subunit beta type}} | ||
+ | {{#set: ec number=EC-3.4.25.1}} | ||
+ | {{#set: gene associated=CHC_T00005811001_1|CHC_T00008987001_1|CHC_T00001498001_1|CHC_T00008987001|CHC_T00009012001_1|CHC_T00005235001_1|CHC_T00008356001_1|CHC_T00008406001_1|CHC_T00009346001_1|CHC_T00009185001_1|CHC_T00008941001_1|CHC_T00009464001_1|CHC_T00008527001_1|CHC_T00009373001_1|CHC_T00008406001|CHC_T00009004001_1|CHC_T00008367001_1|CHC_T00005557001_1|CHC_T00005533001_1|CHC_T00005699001_1|CHC_T00009544001_1}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome|orthology-ectocarpus_siliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 17:32, 9 January 2019
Contents
Reaction 3.4.25.1-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Proteasome subunit alpha type
- Proteasome subunit beta type
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 General-Protein-Substrates[c] + 1 WATER[c] => 1 Peptides-holder[c]
- With common name(s):
- 1 a protein[c] + 1 H2O[c] => 1 a peptide[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00005811001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00008987001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00001498001_1
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00008987001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
- Gene: CHC_T00009012001_1
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00005235001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00008356001_1
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00008406001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00009346001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00009185001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00008941001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00009464001_1
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00008527001_1
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00009373001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00008406001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
- Gene: CHC_T00009004001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00008367001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00005557001_1
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00005533001_1
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00005699001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00009544001_1
- Source: orthology-galdieria.sulphuraria
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome
External links
- UNIPROT:
- Q7DLR9
- P28062
- Q9TRJ7
- P30656
- P30657
- P28074
- P40302
- O24633
- P40303
- Q9V122
- P40306
- P28063
- P25786
- P28076
- O13268
- P34064
- P60901
- P18421
- P18053
- P28072
- P22769
- P25043
- P28065
- P30186
- P60900
- P34065
- P34067
- P40301
- Q8AVD2
- Q7LZF1
- P40307
- P23724
- P28070
- P22141
- P49721
- P49720
- P25156
- Q09682
- Q09720
- P48004
- P38624
- P32379
- Q7LZF0
- P62333
- Q24178
- Q27575
- P21242
- P21243
- P23638
- P23639
- P12881
- P25787
- P20618
- P25788
- P25789
- P18420
- P18422
- P21670
- P52428
- P93395
- O04861
- Q8LD27
- O48551
- O24030
- P42742
- O81147
- O23708
- O24616
- O81149
- Q42134
- P34066
- O23712
- O23710
- Q7DLS1
- O81153
- O23714