Difference between revisions of "RXN0-5063"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-NITROPHENOL P-NITROPHENOL] == * smiles: ** C1(C=C([O-])C=CC=1[N+](=O)[O-]) * inchi key: ** In...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5063 RXN0-5063] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5063 RXN0-5063] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.8.4.3 EC-2.8.4.3] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[6-Dimethylallyladenosine37-tRNAs]][c] '''+''' 1 [[Donor-H2]][c] '''+''' 2 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[Sulfurated-Sulfur-Acceptors]][c] '''=>''' 1 [[CPD-11592]][c] '''+''' 1 [[Acceptor]][c] '''+''' 1 [[CH33ADO]][c] '''+''' 1 [[Unsulfurated-Sulfur-Acceptors]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[MET]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 N6-dimethylallyladenosine37 in tRNA[c] '''+''' 1 a reduced electron acceptor[c] '''+''' 2 S-adenosyl-L-methionine[c] '''+''' 1 a sulfurated [sulfur carrier][c] '''=>''' 1 2-methylthio-N6-dimethylallyladenosine37 in tRNA[c] '''+''' 1 an oxidized electron acceptor[c] '''+''' 1 5'-deoxyadenosine[c] '''+''' 1 an unsulfurated [sulfur carrier][c] '''+''' 1 S-adenosyl-L-homocysteine[c] '''+''' 2 H+[c] '''+''' 1 L-methionine[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[CHC_T00003933001_1]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | * Gene: [[CHC_T00000153001_1]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-2.8.4.3}} | |
| − | + | {{#set: gene associated=CHC_T00003933001_1|CHC_T00000153001_1}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-ectocarpus_siliculosus}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:52, 23 May 2018
Contents
Reaction RXN0-5063
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 6-Dimethylallyladenosine37-tRNAs[c] + 1 Donor-H2[c] + 2 S-ADENOSYLMETHIONINE[c] + 1 Sulfurated-Sulfur-Acceptors[c] => 1 CPD-11592[c] + 1 Acceptor[c] + 1 CH33ADO[c] + 1 Unsulfurated-Sulfur-Acceptors[c] + 1 ADENOSYL-HOMO-CYS[c] + 2 PROTON[c] + 1 MET[c]
- With common name(s):
- 1 N6-dimethylallyladenosine37 in tRNA[c] + 1 a reduced electron acceptor[c] + 2 S-adenosyl-L-methionine[c] + 1 a sulfurated [sulfur carrier][c] => 1 2-methylthio-N6-dimethylallyladenosine37 in tRNA[c] + 1 an oxidized electron acceptor[c] + 1 5'-deoxyadenosine[c] + 1 an unsulfurated [sulfur carrier][c] + 1 S-adenosyl-L-homocysteine[c] + 2 H+[c] + 1 L-methionine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00003933001_1
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00000153001_1
- Source: orthology-ectocarpus_siliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
