Difference between revisions of "CHC 255"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11517 CPD-11517] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11517 CPD-11517] ==
+
== Gene CHC_255 ==
−
* smiles:
+
−
** CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
−
* inchi key:
+
−
** InChIKey=JZIQDJLBFKTBAK-HUKDABTFSA-J
+
 
* common name:
 
* common name:
−
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA
+
** hisS
−
* molecular weight:
+
* left end position:
−
** 1039.92    
+
** 37082
 +
* transcription direction:
 +
** POSITIVE
 +
* right end position:
 +
** 38335
 +
* centisome position:
 +
** 20.591272    
 
* Synonym(s):
 
* Synonym(s):
−
** oxopentenyl-cyclopentane-octanoyl-CoA
 
−
** 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA
 
−
** OPC-8:0-CoA
 
−
** OPC8-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10696]]
+
* Reaction: [[HISTIDINE--TRNA-LIGASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-original_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[TRNA-CHARGING-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=hisS}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237325 44237325]
+
{{#set: left end position=37082}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: inchi key=InChIKey=JZIQDJLBFKTBAK-HUKDABTFSA-J}}
+
{{#set: right end position=38335}}
−
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA}}
+
{{#set: centisome position=20.591272   }}
−
{{#set: molecular weight=1039.92   }}
+
{{#set: reaction associated=HISTIDINE--TRNA-LIGASE-RXN}}
−
{{#set: common name=oxopentenyl-cyclopentane-octanoyl-CoA|8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA|OPC-8:0-CoA|OPC8-CoA}}
+
{{#set: pathway associated=TRNA-CHARGING-PWY}}
−
{{#set: consumed by=RXN-10696}}
+

Latest revision as of 16:24, 9 January 2019

Gene CHC_255

  • common name:
    • hisS
  • left end position:
    • 37082
  • transcription direction:
    • POSITIVE
  • right end position:
    • 38335
  • centisome position:
    • 20.591272
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_255&oldid=21694"