Difference between revisions of "CPD-14423"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009425001 == * left end position: ** 380280 * transcription direction: ** POSITIVE * right end position: ** 381422 * centisome position: ** 58...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14423 CPD-14423] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1089.98 |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=SLYKKQSPRFJDAF-HVGANWHPSA-J |
| − | * | + | * common name: |
| − | ** | + | ** 3-oxo-docosapentaenoyl-CoA |
* Synonym(s): | * Synonym(s): | ||
| + | ** (5Z,8Z,11Z,14Z,17Z)-3-oxo-docosa-5,8,11,14,17-pentaenoyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | * [[RXN-13443]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73863 73863] |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581097 71581097] |
| − | {{#set: | + | {{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: molecular weight=1089.98 }} |
| + | {{#set: inchi key=InChIKey=SLYKKQSPRFJDAF-HVGANWHPSA-J}} | ||
| + | {{#set: common name=3-oxo-docosapentaenoyl-CoA}} | ||
| + | {{#set: common name=(5Z,8Z,11Z,14Z,17Z)-3-oxo-docosa-5,8,11,14,17-pentaenoyl-CoA}} | ||
| + | {{#set: consumed by=RXN-13443}} | ||
Latest revision as of 16:36, 9 January 2019
Contents
Metabolite CPD-14423
- smiles:
- CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 1089.98
- inchi key:
- InChIKey=SLYKKQSPRFJDAF-HVGANWHPSA-J
- common name:
- 3-oxo-docosapentaenoyl-CoA
- Synonym(s):
- (5Z,8Z,11Z,14Z,17Z)-3-oxo-docosa-5,8,11,14,17-pentaenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
