Difference between revisions of "CPD-9873"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008941001_1 == * Synonym(s): == Reactions associated == * 3.4.25.1-RXN ** pantograph-galdieria.sulphuraria == Pathways associated...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9873 CPD-9873] == |
+ | * smiles: | ||
+ | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C(C)C(O)=C(OC)C(O)=C(O)1) | ||
+ | * molecular weight: | ||
+ | ** 851.347 | ||
+ | * inchi key: | ||
+ | ** InChIKey=NNUPTRSALHLEEI-AVRCVIBKSA-N | ||
+ | * common name: | ||
+ | ** 3-demethylubiquinol-10 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-9237]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN-9236]] |
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64182 64182] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986074 50986074] | ||
+ | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C(C)C(O)=C(OC)C(O)=C(O)1)}} | ||
+ | {{#set: molecular weight=851.347 }} | ||
+ | {{#set: inchi key=InChIKey=NNUPTRSALHLEEI-AVRCVIBKSA-N}} | ||
+ | {{#set: common name=3-demethylubiquinol-10}} | ||
+ | {{#set: consumed by=RXN-9237}} | ||
+ | {{#set: produced by=RXN-9236}} |
Latest revision as of 17:38, 9 January 2019
Contents
Metabolite CPD-9873
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C(C)C(O)=C(OC)C(O)=C(O)1)
- molecular weight:
- 851.347
- inchi key:
- InChIKey=NNUPTRSALHLEEI-AVRCVIBKSA-N
- common name:
- 3-demethylubiquinol-10
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links