Difference between revisions of "FeS-Cluster-Chaperones-ATP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8611 CPD-8611] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(CO)...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FeS-Cluster-Chaperones-ATP FeS-Cluster-Chaperones-ATP] == * common name: ** an [Fe-S cluster bi...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8611 CPD-8611] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FeS-Cluster-Chaperones-ATP FeS-Cluster-Chaperones-ATP] ==
* smiles:
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(CO)C(O)CC3)))CC4)))C
+
* inchi key:
+
** InChIKey=UVSRXDFMOZKKGE-WKYRUEGDSA-N
+
 
* common name:
 
* common name:
** 4α-hydroxymethyl-4β-methyl-5α-cholesta-8-en-3β-ol
+
** an [Fe-S cluster biosynthesis chaperone]-ATP
* molecular weight:
+
** 430.713   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-16]]
+
* [[RXN-14389]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-15]]
+
* [[RXN-14391]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an [Fe-S cluster biosynthesis chaperone]-ATP}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263321 44263321]
+
{{#set: consumed by=RXN-14389}}
* CHEBI:
+
{{#set: produced by=RXN-14391}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87045 87045]
+
* HMDB : HMDB12171
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(CO)C(O)CC3)))CC4)))C}}
+
{{#set: inchi key=InChIKey=UVSRXDFMOZKKGE-WKYRUEGDSA-N}}
+
{{#set: common name=4α-hydroxymethyl-4β-methyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: molecular weight=430.713    }}
+
{{#set: consumed by=RXN66-16}}
+
{{#set: produced by=RXN66-15}}
+

Latest revision as of 16:55, 23 May 2018

Metabolite FeS-Cluster-Chaperones-ATP

  • common name:
    • an [Fe-S cluster biosynthesis chaperone]-ATP
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an [Fe-S cluster biosynthesis chaperone]-ATP" cannot be used as a page name in this wiki.