Difference between revisions of "PWY-5703"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] == * smiles: ** CC(=O)NC(CCSC)C([O-])=O * inchi key: ** InChIKey=XUYPXLNMD...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5703 PWY-5703] ==
* smiles:
+
** CC(=O)NC(CCSC)C([O-])=O
+
* inchi key:
+
** InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M
+
 
* common name:
 
* common name:
** Nα-acetyl-L-methionine
+
** urea degradation I
* molecular weight:
+
* taxonomic range:
** 190.237   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-3041]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2763 TAX-2763]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 
* Synonym(s):
 
* Synonym(s):
** N-acetyl-L-methionine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''2''' reactions in the full pathway
* [[RXN0-6948]]
+
* [[ALLOPHANATE-HYDROLASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[CHC_T00009441001]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
* [[UREA-CARBOXYLASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009426001]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB01646
+
{{#set: common name=urea degradation I}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6991985 6991985]
+
{{#set: taxonomic range=TAX-3041}}
* HMDB : HMDB11745
+
{{#set: taxonomic range=TAX-2763}}
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-4751}}
** [http://www.genome.jp/dbget-bin/www_bget?C02712 C02712]
+
{{#set: reaction found=2}}
* CHEMSPIDER:
+
{{#set: total reaction=2}}
** [http://www.chemspider.com/Chemical-Structure.395338.html 395338]
+
{{#set: completion rate=100.0}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71670 71670]
+
{{#set: smiles=CC(=O)NC(CCSC)C([O-])=O}}
+
{{#set: inchi key=InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M}}
+
{{#set: common name=Nα-acetyl-L-methionine}}
+
{{#set: molecular weight=190.237    }}
+
{{#set: common name=N-acetyl-L-methionine}}
+
{{#set: produced by=RXN0-6948}}
+

Latest revision as of 16:30, 9 January 2019

Pathway PWY-5703

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links