Difference between revisions of "CHC T00008407001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17813 CPD-17813] == * smiles: ** CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=...")
 
(Created page with "Category:Gene == Gene CHC_T00008407001_1 == * Synonym(s): == Reactions associated == * Reaction: RXN-11356 ** Source: orthology-ectocarpus_siliculosus * Reaction:...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17813 CPD-17813] ==
+
== Gene CHC_T00008407001_1 ==
−
* smiles:
+
−
** CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
+
−
* inchi key:
+
−
** InChIKey=AMSSMXHTRODKSM-FYYFNCOUSA-J
+
−
* common name:
+
−
** (2E,11Z)-hexadec-2,11-dienoyl-CoA
+
−
* molecular weight:
+
−
** 997.883   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16558]]
+
* Reaction: [[RXN-11356]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-ectocarpus_siliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-11357]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Reaction: [[RXN-12242]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-6475]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: reaction associated=RXN-11356|RXN-11357|RXN-12242}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819958 91819958]
+
{{#set: pathway associated=PWY-6475}}
−
{{#set: smiles=CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}}
+
−
{{#set: inchi key=InChIKey=AMSSMXHTRODKSM-FYYFNCOUSA-J}}
+
−
{{#set: common name=(2E,11Z)-hexadec-2,11-dienoyl-CoA}}
+
−
{{#set: molecular weight=997.883    }}
+
−
{{#set: consumed by=RXN-16558}}
+

Latest revision as of 15:55, 23 May 2018

Gene CHC_T00008407001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00008407001_1&oldid=15735"