Difference between revisions of "RXN-9362"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-SEMIALDEHYDE L-ASPARTATE-SEMIALDEHYDE] == * smiles: ** [CH](=O)CC([N+])C(=O)[O-] *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9362 RXN-9362] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9362 RXN-9362] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/2.1.1.163 EC-2.1.1.163] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD-12120]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[CPD-12128]][c] '''+''' 1 [[PROTON]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 demethylmenaquinol-11[c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 menaquinol-11[c] '''+''' 1 H+[c] |
− | == | + | |
− | == | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
+ | * Gene: [[CHC_T00000517001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00001339001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00000214001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00005416001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5891]], menaquinol-11 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5891 PWY-5891] | ||
+ | ** '''1''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-2.1.1.163}} | |
− | + | {{#set: gene associated=CHC_T00000517001_1|CHC_T00001339001_1|CHC_T00000214001_1|CHC_T00005416001_1}} | |
− | + | {{#set: in pathway=PWY-5891}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 15:55, 23 May 2018
Contents
Reaction RXN-9362
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-12120[c] + 1 S-ADENOSYLMETHIONINE[c] => 1 ADENOSYL-HOMO-CYS[c] + 1 CPD-12128[c] + 1 PROTON[c]
- With common name(s):
- 1 demethylmenaquinol-11[c] + 1 S-adenosyl-L-methionine[c] => 1 S-adenosyl-L-homocysteine[c] + 1 menaquinol-11[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00000517001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00001339001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00000214001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00005416001_1
- Source: orthology-galdieria.sulphuraria
Pathways
- PWY-5891, menaquinol-11 biosynthesis: PWY-5891
- 1 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria