Difference between revisions of "HECT-Ubiquitin-carrier-protein-E3-L-cys"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * inchi key: ** InChIKe...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HECT-Ubiquitin-carrier-protein-E3-L-cys HECT-Ubiquitin-carrier-protein-E3-L-cys] == * common na...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HECT-Ubiquitin-carrier-protein-E3-L-cys HECT-Ubiquitin-carrier-protein-E3-L-cys] ==
−
* smiles:
+
−
** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)
+
−
* inchi key:
+
−
** InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L
+
 
* common name:
 
* common name:
−
** (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
+
** a [HECT-type E3 ubiquitin transferase]-L-cysteine
−
* molecular weight:
+
−
** 185.136   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-14014]]
+
* [[RXN-15559]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[DIHYDRODIPICSYN-RXN]]
+
* [[RXN-15560]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a [HECT-type E3 ubiquitin transferase]-L-cysteine}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678847 70678847]
+
{{#set: consumed by=RXN-15559}}
−
* CHEBI:
+
{{#set: produced by=RXN-15560}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67139 67139]
+
−
{{#set: smiles=C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)}}
+
−
{{#set: inchi key=InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L}}
+
−
{{#set: common name=(2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate}}
+
−
{{#set: molecular weight=185.136    }}
+
−
{{#set: common name=(4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate}}
+
−
{{#set: consumed by=RXN-14014}}
+
−
{{#set: produced by=DIHYDRODIPICSYN-RXN}}
+

Latest revision as of 15:56, 23 May 2018

Metabolite HECT-Ubiquitin-carrier-protein-E3-L-cys

  • common name:
    • a [HECT-type E3 ubiquitin transferase]-L-cysteine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [HECT-type E3 ubiquitin transferase]-L-cysteine" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=HECT-Ubiquitin-carrier-protein-E3-L-cys&oldid=15773"