Difference between revisions of "CHC T00003782001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE-1P GALACTOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi ke...") |
(Created page with "Category:Gene == Gene CHC_T00003782001_1 == * Synonym(s): == Reactions associated == * Reaction: D-AMINO-ACID-OXIDASE-RXN ** Source: orthology-galdieria.sulphuraria...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00003782001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[D-AMINO-ACID-OXIDASE-RXN]] | |
− | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
− | * [[ | + | * Reaction: [[RXN-8163]] |
− | * [[ | + | ** Source: [[orthology-galdieria.sulphuraria]] |
− | * [[ | + | == Pathways associated == |
+ | * [[PWY-5283]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=D-AMINO-ACID-OXIDASE-RXN|RXN-8163}} | |
− | + | {{#set: pathway associated=PWY-5283}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 15:57, 23 May 2018
Gene CHC_T00003782001_1
- Synonym(s):
Reactions associated
- Reaction: D-AMINO-ACID-OXIDASE-RXN
- Source: orthology-galdieria.sulphuraria
- Reaction: RXN-8163
- Source: orthology-galdieria.sulphuraria