Difference between revisions of "RXN1G-2544"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12218 CPD-12218] == * smiles: ** C(CC(O)C1(=CC=CC=C1))([O-])=O * common name: ** 3-hydroxy-...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12218 CPD-12218] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-2544 RXN1G-2544] ==
−
* smiles:
+
* direction:
−
** C(CC(O)C1(=CC=CC=C1))([O-])=O
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 3-hydroxy-3-phenylpropanoate
+
** cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase
−
* inchi key:
+
** Cyclopropane-fatty-acyl-phospholipid synthase family
−
** InChIKey=AYOLELPCNDVZKZ-UHFFFAOYSA-M
+
* ec number:
−
* molecular weight:
+
** [http://enzyme.expasy.org/EC/2.1.1.79 EC-2.1.1.79]
−
** 165.168   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-hydroxy-3-phenyl propionic acid
 
−
** 3-hydroxy-3-phenylpropionate
 
−
** beta-hydroxyphenylpropionic acid
 
−
** 3-hydroxy-3-phenylpropanoic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11270]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[cis-D19-37-MOH-38-Me-C57-1-ACPs]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[cis-19-CP-37-Mex-38-Me-C59-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c]
−
* [[RXN-11269]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 a cis-delta19-37-methoxy-38-methyl-C57:1-[acp][c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 a cis-methoxy-C59-meroacyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 S-adenosyl-L-homocysteine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00005488001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00006042001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00003092001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00009019001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''20''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22328018 22328018]
+
{{#set: common name=cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase}}
−
* CHEMSPIDER:
+
{{#set: common name=Cyclopropane-fatty-acyl-phospholipid synthase family}}
−
** [http://www.chemspider.com/Chemical-Structure.11347248.html 11347248]
+
{{#set: ec number=EC-2.1.1.79}}
−
* CHEBI:
+
{{#set: gene associated=CHC_T00005488001_1|CHC_T00006042001_1|CHC_T00003092001_1|CHC_T00009019001}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63469 63469]
+
{{#set: in pathway=PWYG-321}}
−
{{#set: smiles=C(CC(O)C1(=CC=CC=C1))([O-])=O}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: common name=3-hydroxy-3-phenylpropanoate}}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome|orthology-ectocarpus_siliculosus}}
−
{{#set: inchi key=InChIKey=AYOLELPCNDVZKZ-UHFFFAOYSA-M}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: molecular weight=165.168    }}
+
−
{{#set: common name=3-hydroxy-3-phenyl propionic acid|3-hydroxy-3-phenylpropionate|beta-hydroxyphenylpropionic acid|3-hydroxy-3-phenylpropanoic acid}}
+
−
{{#set: consumed by=RXN-11270}}
+
−
{{#set: produced by=RXN-11269}}
+

Latest revision as of 16:38, 9 January 2019

Reaction RXN1G-2544

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase
    • Cyclopropane-fatty-acyl-phospholipid synthase family
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 20 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN1G-2544&oldid=22045"