Difference between revisions of "CPD0-2030"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-240 RXN1G-240] == * direction: ** LEFT-TO-RIGHT * common name: ** cis-delta9-3-oxo-C28:1-[acy...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O |
| + | * molecular weight: | ||
| + | ** 258.144 | ||
| + | * inchi key: | ||
| + | ** InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** glycerophosphoserine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-14136]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * CHEBI: | |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61931 61931] |
| − | {{#set: | + | * BIGG : g3ps |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339260 57339260] |
| − | {{#set: | + | {{#set: smiles=C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O}} |
| − | + | {{#set: molecular weight=258.144 }} | |
| + | {{#set: inchi key=InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M}} | ||
| + | {{#set: common name=glycerophosphoserine}} | ||
| + | {{#set: consumed by=RXN-14136}} | ||
Latest revision as of 16:42, 9 January 2019
Contents
Metabolite CPD0-2030
- smiles:
- C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O
- molecular weight:
- 258.144
- inchi key:
- InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M
- common name:
- glycerophosphoserine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O" cannot be used as a page name in this wiki.
