Difference between revisions of "REDUCED-MENAQUINONE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008521001 == * left end position: ** 49917 * transcription direction: ** POSITIVE * right end position: ** 51443 * centisome position: ** 11.2...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=REDUCED-MENAQUINONE REDUCED-MENAQUINONE] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(=CC=CC=C1C(O)=2)) |
| − | * | + | * molecular weight: |
| − | ** | + | ** 719.144 |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=OIEZRVBFVPGODT-WQWYCSGDSA-N |
| − | * | + | * common name: |
| − | ** | + | ** menaquinol-8 |
* Synonym(s): | * Synonym(s): | ||
| + | ** reduced menaquinone-8 | ||
| + | ** MKH2-8 | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[ADOMET-DMK-METHYLTRANSFER-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61684 61684] |
| − | {{#set: | + | * BIGG : mql8 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479636 45479636] |
| + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(=CC=CC=C1C(O)=2))}} | ||
| + | {{#set: molecular weight=719.144 }} | ||
| + | {{#set: inchi key=InChIKey=OIEZRVBFVPGODT-WQWYCSGDSA-N}} | ||
| + | {{#set: common name=menaquinol-8}} | ||
| + | {{#set: common name=reduced menaquinone-8|MKH2-8}} | ||
| + | {{#set: produced by=ADOMET-DMK-METHYLTRANSFER-RXN}} | ||
Latest revision as of 16:42, 9 January 2019
Contents
Metabolite REDUCED-MENAQUINONE
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(=CC=CC=C1C(O)=2))
- molecular weight:
- 719.144
- inchi key:
- InChIKey=OIEZRVBFVPGODT-WQWYCSGDSA-N
- common name:
- menaquinol-8
- Synonym(s):
- reduced menaquinone-8
- MKH2-8
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
