Difference between revisions of "PWY-6115"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(=O)[O-] * inchi key:...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6115 PWY-6115] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** avenacin biosynthesis, initial reactions |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4496 TAX-4496] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''2''' reactions in the full pathway |
| − | + | * [[CYCLOARTENOL-SYNTHASE-RXN]] | |
| − | == Reaction(s) | + | ** 2 associated gene(s): |
| + | *** [[CHC_T00008265001]] | ||
| + | *** [[CHC_T00008265001_1]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[annotation-original_genome]] | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7570 RXN-7570] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=avenacin biosynthesis, initial reactions}} | |
| − | + | {{#set: taxonomic range=TAX-4496}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=2}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 16:34, 9 January 2019
Pathway PWY-6115
- common name:
- avenacin biosynthesis, initial reactions
- taxonomic range:
- Synonym(s):
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- CYCLOARTENOL-SYNTHASE-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
