Difference between revisions of "CPD-13717"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6531 PWY-6531] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2870 TAX-28...") |
|||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == |
− | * | + | * smiles: |
− | ** [ | + | ** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] |
− | ** | + | * molecular weight: |
+ | ** 269.159 | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** L-selenocystathionine |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-12729]] |
− | + | * [[RXN-15137]] | |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * CHEBI: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62226 62226] |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52921580 52921580] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05699 C05699] |
− | {{#set: | + | * HMDB : HMDB06343 |
+ | {{#set: smiles=C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-]}} | ||
+ | {{#set: molecular weight=269.159 }} | ||
+ | {{#set: inchi key=InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N}} | ||
+ | {{#set: common name=L-selenocystathionine}} | ||
+ | {{#set: consumed by=RXN-12729|RXN-15137}} |
Latest revision as of 17:44, 9 January 2019
Contents
Metabolite CPD-13717
- smiles:
- C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-]
- molecular weight:
- 269.159
- inchi key:
- InChIKey=ZNWYDQPOUQRDLY-WHFBIAKZSA-N
- common name:
- L-selenocystathionine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-" cannot be used as a page name in this wiki.