Difference between revisions of "5734-TETRAHYDROXYFLAVONE"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4302 PWY-4302] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-3...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5734-TETRAHYDROXYFLAVONE 5734-TETRAHYDROXYFLAVONE] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C1(=C(C=C(O)C(O)=C1)C2(OC3(C=C([O-])C=C(O)C(C(=O)C=2)=3))) |
| − | ** | + | * molecular weight: |
| − | ** | + | ** 285.232 |
| + | * inchi key: | ||
| + | ** InChIKey=IQPNAANSBPBGFQ-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** luteolin |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3',4',5,7-tetrahydroxyflavone |
| + | ** 5,7,3',4'-tetrahydroxyflavone | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-7651]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * CHEBI: |
| − | ** [http:// | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57545 57545] |
| − | {{#set: | + | * CAS : 491-70-3 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201972 25201972] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: common name | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01514 C01514] |
| − | + | * HMDB : HMDB05800 | |
| − | {{#set: | + | {{#set: smiles=C1(=C(C=C(O)C(O)=C1)C2(OC3(C=C([O-])C=C(O)C(C(=O)C=2)=3)))}} |
| + | {{#set: molecular weight=285.232 }} | ||
| + | {{#set: inchi key=InChIKey=IQPNAANSBPBGFQ-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=luteolin}} | ||
| + | {{#set: common name=3',4',5,7-tetrahydroxyflavone|5,7,3',4'-tetrahydroxyflavone}} | ||
| + | {{#set: produced by=RXN-7651}} | ||
Latest revision as of 16:44, 9 January 2019
Contents
Metabolite 5734-TETRAHYDROXYFLAVONE
- smiles:
- C1(=C(C=C(O)C(O)=C1)C2(OC3(C=C([O-])C=C(O)C(C(=O)C=2)=3)))
- molecular weight:
- 285.232
- inchi key:
- InChIKey=IQPNAANSBPBGFQ-UHFFFAOYSA-M
- common name:
- luteolin
- Synonym(s):
- 3',4',5,7-tetrahydroxyflavone
- 5,7,3',4'-tetrahydroxyflavone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=C(C=C(O)C(O)=C1)C2(OC3(C=C([O-])C=C(O)C(C(=O)C=2)=3)))" cannot be used as a page name in this wiki.
