Difference between revisions of "PWY-7385"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == * smiles: ** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] * inchi key: **...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7385 PWY-7385] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 1,3-propanediol biosynthesis (engineered) |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 1,3-PDO biosynthesis | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''5''' reactions found over '''9''' reactions in the full pathway |
| − | * [[RXN- | + | * [[1.1.1.8-RXN]] |
| − | == Reaction(s) | + | ** 2 associated gene(s): |
| − | == | + | *** [[CHC_T00009494001_1]] |
| + | *** [[CHC_T00008461001_1]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[6PFRUCTPHOS-RXN]] | ||
| + | ** 3 associated gene(s): | ||
| + | *** [[CHC_T00009387001_1]] | ||
| + | *** [[CHC_T00008955001]] | ||
| + | *** [[CHC_T00007415001_1]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[annotation-original_genome]] | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[F16ALDOLASE-RXN]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[CHC_T00008586001]] | ||
| + | *** [[CHC_T00008586001_1]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[annotation-original_genome]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[GLUCOKIN-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[CHC_T00001373001_1]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[PGLUCISOM-RXN]] | ||
| + | ** 3 associated gene(s): | ||
| + | *** [[CHC_T00009370001]] | ||
| + | *** [[CHC_T00009370001_1]] | ||
| + | *** [[CHC_T00008268001_1]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[annotation-original_genome]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-DEHYDRATASE-RXN GLYCEROL-DEHYDRATASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14965 RXN-14965] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6487 RXN0-6487] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7077 RXN0-7077] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=1,3-propanediol biosynthesis (engineered)}} | |
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=1,3-PDO biosynthesis}} | |
| − | + | {{#set: reaction found=5}} | |
| − | + | {{#set: total reaction=9}} | |
| − | + | {{#set: completion rate=56.00000000000001}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 16:35, 9 January 2019
Pathway PWY-7385
- common name:
- 1,3-propanediol biosynthesis (engineered)
- taxonomic range:
- Synonym(s):
- 1,3-PDO biosynthesis
Reaction(s) found
5 reactions found over 9 reactions in the full pathway
- 1.1.1.8-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- 6PFRUCTPHOS-RXN
- 3 associated gene(s):
- 4 reconstruction source(s) associated:
- F16ALDOLASE-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
- GLUCOKIN-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- PGLUCISOM-RXN
- 3 associated gene(s):
- 3 reconstruction source(s) associated:
