Difference between revisions of "RXN-12399"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14675 CPD-14675] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12399 RXN-12399] == * direction: ** LEFT-TO-RIGHT * common name: ** xyloglucan XLXG oligosaccha...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14675 CPD-14675] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12399 RXN-12399] ==
* smiles:
+
* direction:
** CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J
+
 
* common name:
 
* common name:
** pristanoyl-CoA
+
** xyloglucan XLXG oligosaccharide β-galactosidase
* molecular weight:
+
* ec number:
** 1043.995   
+
** [http://enzyme.expasy.org/EC/3.2.1.23 EC-3.2.1.23]
 
* Synonym(s):
 
* Synonym(s):
** 2,6,10,14-tetramethylpentadecanoyl-CoA
 
** 2,6,10,14-tetramethylpentadecanoyl-coenzyme A
 
** pristanoyl-coenzyme A
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN66-484]]
+
** 1 [[CPD-13377]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[D-galactopyranose]][c] '''+''' 1 [[CPD-13375]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 XLXG xyloglucan oligosaccharide[c] '''+''' 1 H2O[c] '''=>''' 1 D-galactopyranose[c] '''+''' 1 XXXG xyloglucan oligosaccharide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008905001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00008606001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-6807]], xyloglucan degradation II (exoglucanase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6807 PWY-6807]
 +
** '''3''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289196 86289196]
+
{{#set: common name=xyloglucan XLXG oligosaccharide β-galactosidase}}
* CHEBI:
+
{{#set: ec number=EC-3.2.1.23}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77250 77250]
+
{{#set: gene associated=CHC_T00008905001_1|CHC_T00008606001_1}}
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: in pathway=PWY-6807}}
{{#set: inchi key=InChIKey=XYJPSQPVCBNZHT-TUKYSRJDSA-J}}
+
{{#set: reconstruction category=orthology}}
{{#set: common name=pristanoyl-CoA}}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
{{#set: molecular weight=1043.995    }}
+
{{#set: reconstruction tool=pantograph}}
{{#set: common name=2,6,10,14-tetramethylpentadecanoyl-CoA|2,6,10,14-tetramethylpentadecanoyl-coenzyme A|pristanoyl-coenzyme A}}
+
{{#set: produced by=RXN66-484}}
+

Latest revision as of 17:01, 23 May 2018

Reaction RXN-12399

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • xyloglucan XLXG oligosaccharide β-galactosidase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 XLXG xyloglucan oligosaccharide[c] + 1 H2O[c] => 1 D-galactopyranose[c] + 1 XXXG xyloglucan oligosaccharide[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6807, xyloglucan degradation II (exoglucanase): PWY-6807
    • 3 reactions found over 6 reactions in the full pathway

Reconstruction information

External links