|
|
(2 intermediate revisions by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1TRANSKETO-RXN 1TRANSKETO-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15364 CPD-15364] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CCCCCCC(O)CC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
| + | * molecular weight: |
| + | ** 1043.952 |
| + | * inchi key: |
| + | ** InChIKey=BHVZCCKRRPYXCV-MGNVXPIMSA-J |
| * common name: | | * common name: |
− | ** transketolase | + | ** ricinoleoyl-CoA |
− | * ec number:
| + | |
− | ** [http://enzyme.expasy.org/EC/2.2.1.1 EC-2.2.1.1]
| + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** 12-hydroxy-9-octadecenoyl-CoA |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[GAP]][c] '''+''' 1 [[D-SEDOHEPTULOSE-7-P]][c] '''<=>''' 1 [[RIBOSE-5P]][c] '''+''' 1 [[XYLULOSE-5-PHOSPHATE]][c]
| + | == Reaction(s) of unknown directionality == |
− | * With common name(s):
| + | * [[RXN-16151]] |
− | ** 1 D-glyceraldehyde 3-phosphate[c] '''+''' 1 D-sedoheptulose 7-phosphate[c] '''<=>''' 1 D-ribose 5-phosphate[c] '''+''' 1 D-xylulose 5-phosphate[c]
| + | |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[CHC_T00005040001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | * [[CHC_T00009390001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | == Pathways == | + | |
− | * [[P124-PWY]], Bifidobacterium shunt: [http://metacyc.org/META/NEW-IMAGE?object=P124-PWY P124-PWY]
| + | |
− | ** '''11''' reactions found over '''15''' reactions in the full pathway
| + | |
− | * [[CALVIN-PWY]], Calvin-Benson-Bassham cycle: [http://metacyc.org/META/NEW-IMAGE?object=CALVIN-PWY CALVIN-PWY]
| + | |
− | ** '''13''' reactions found over '''13''' reactions in the full pathway
| + | |
− | * [[P21-PWY]], pentose phosphate pathway (partial): [http://metacyc.org/META/NEW-IMAGE?object=P21-PWY P21-PWY]
| + | |
− | ** '''3''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-5723]], Rubisco shunt: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5723 PWY-5723]
| + | |
− | ** '''10''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[PWY-1861]], formaldehyde assimilation II (RuMP Cycle): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1861 PWY-1861]
| + | |
− | ** '''7''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[P185-PWY]], formaldehyde assimilation III (dihydroxyacetone cycle): [http://metacyc.org/META/NEW-IMAGE?object=P185-PWY P185-PWY]
| + | |
− | ** '''10''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[NONOXIPENT-PWY]], pentose phosphate pathway (non-oxidative branch): [http://metacyc.org/META/NEW-IMAGE?object=NONOXIPENT-PWY NONOXIPENT-PWY]
| + | |
− | ** '''5''' reactions found over '''5''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * [[orthology]]: | + | |
− | ** [[pantograph]]:
| + | |
− | *** [[galdieria.sulphuraria]]
| + | |
− | *** [[a.taliana]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[original_genome]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10508 10508] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658767 90658767] |
− | * LIGAND-RXN:
| + | {{#set: smiles=CCCCCCC(O)CC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R01641 R01641]
| + | {{#set: molecular weight=1043.952 }} |
− | * UNIPROT:
| + | {{#set: inchi key=InChIKey=BHVZCCKRRPYXCV-MGNVXPIMSA-J}} |
− | ** [http://www.uniprot.org/uniprot/P29401 P29401]
| + | {{#set: common name=ricinoleoyl-CoA}} |
− | ** [http://www.uniprot.org/uniprot/P33570 P33570]
| + | {{#set: common name=12-hydroxy-9-octadecenoyl-CoA}} |
− | ** [http://www.uniprot.org/uniprot/P21725 P21725]
| + | {{#set: reversible reaction associated=RXN-16151}} |
− | ** [http://www.uniprot.org/uniprot/Q58094 Q58094]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JTR1 Q9JTR1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CF56 Q9CF56]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21726 P21726]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47312 P47312]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PM31 Q9PM31]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43757 P43757]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q58092 Q58092]
| + | |
− | ** [http://www.uniprot.org/uniprot/P45694 P45694]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q52723 Q52723]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Z475 Q9Z475]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34736 P34736]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33315 P33315]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42675 Q42675]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42676 Q42676]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42677 Q42677]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46708 P46708]
| + | |
− | ** [http://www.uniprot.org/uniprot/P75611 P75611]
| + | |
− | ** [http://www.uniprot.org/uniprot/P73282 P73282]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49047 Q49047]
| + | |
− | ** [http://www.uniprot.org/uniprot/O20250 O20250]
| + | |
− | ** [http://www.uniprot.org/uniprot/O78327 O78327]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9URM2 Q9URM2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RFB7 Q9RFB7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23254 P23254]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27302 P27302]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29277 P29277]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22976 P22976]
| + | |
− | {{#set: direction=REVERSIBLE}}
| + | |
− | {{#set: common name=transketolase}} | + | |
− | {{#set: ec number=EC-2.2.1.1}} | + | |
− | {{#set: gene associated=CHC_T00005040001_1|CHC_T00009390001_1}} | + | |
− | {{#set: in pathway=P124-PWY|CALVIN-PWY|P21-PWY|PWY-5723|PWY-1861|P185-PWY|NONOXIPENT-PWY}} | + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}}
| + | |
− | {{#set: reconstruction source=galdieria.sulphuraria|a.taliana}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=original_genome}}
| + | |