Difference between revisions of "CPD-19158"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Nonmethylated-Ribosomal-Protein-L11s Nonmethylated-Ribosomal-Protein-L11s] == * common name: **...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] == |
| + | * smiles: | ||
| + | ** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
| + | * molecular weight: | ||
| + | ** 1013.883 | ||
| + | * inchi key: | ||
| + | ** InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-oxo-(9Z)-hexadecenoyl-CoA |
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-oxo-16:1-Δ9-CoA | ||
| + | ** 3-oxo-9-cis-hexadecenoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17791]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-17790]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | {{#set: smiles=CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: consumed by= | + | {{#set: molecular weight=1013.883 }} |
| + | {{#set: inchi key=InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J}} | ||
| + | {{#set: common name=3-oxo-(9Z)-hexadecenoyl-CoA}} | ||
| + | {{#set: common name=3-oxo-16:1-Δ9-CoA|3-oxo-9-cis-hexadecenoyl-CoA}} | ||
| + | {{#set: consumed by=RXN-17791}} | ||
| + | {{#set: produced by=RXN-17790}} | ||
Latest revision as of 17:46, 9 January 2019
Contents
Metabolite CPD-19158
- smiles:
- CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 1013.883
- inchi key:
- InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J
- common name:
- 3-oxo-(9Z)-hexadecenoyl-CoA
- Synonym(s):
- 3-oxo-16:1-Δ9-CoA
- 3-oxo-9-cis-hexadecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
