Difference between revisions of "PWY-7220"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYLSERINE ACETYLSERINE] == * smiles: ** CC(OCC([N+])C(=O)[O-])=O * inchi key: ** InChIKey=VZ...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYLSERINE ACETYLSERINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7220 PWY-7220] ==
* smiles:
+
** CC(OCC([N+])C(=O)[O-])=O
+
* inchi key:
+
** InChIKey=VZXPDPZARILFQX-BYPYZUCNSA-N
+
 
* common name:
 
* common name:
** O-acetyl-L-serine
+
** adenosine deoxyribonucleotides de novo biosynthesis II
* molecular weight:
+
* taxonomic range:
** 147.13   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
** O3-acetyl-L-serine
 
** acetylserine
 
** O-acetylserine
 
** (2S)-3-acetyloxy-2-aminopropanoate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-12726]]
+
'''3''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ADPREDUCT-RXN]]
* [[SERINE-O-ACETTRAN-RXN]]
+
** 4 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00008926001_1]]
* [[ACSERLY-RXN]]
+
*** [[CHC_T00008926001]]
* [[SULFOCYS-RXN]]
+
*** [[CHC_T00008864001_1]]
 +
*** [[CHC_T00008864001]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[DADPKIN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00009233001]]
 +
*** [[CHC_T00009233001_1]]
 +
*** [[CHC_T00009258001_1]]
 +
*** [[CHC_T00009258001]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN0-747]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008926001]]
 +
*** [[CHC_T00008864001]]
 +
*** [[CHC_T00008926001_1]]
 +
*** [[CHC_T00008864001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-745 RXN0-745]
 
== External links  ==
 
== External links  ==
* CAS : 66638-22-0
+
* ECOCYC:
* METABOLIGHTS : MTBLC17981
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7220 PWY-7220]
* PUBCHEM:
+
{{#set: common name=adenosine deoxyribonucleotides de novo biosynthesis II}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971051 6971051]
+
{{#set: taxonomic range=TAX-2}}
* HMDB : HMDB03011
+
{{#set: reaction found=3}}
* LIGAND-CPD:
+
{{#set: total reaction=4}}
** [http://www.genome.jp/dbget-bin/www_bget?C00979 C00979]
+
{{#set: completion rate=75.0}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58340 58340]
+
* BIGG : acser
+
{{#set: smiles=CC(OCC([N+])C(=O)[O-])=O}}
+
{{#set: inchi key=InChIKey=VZXPDPZARILFQX-BYPYZUCNSA-N}}
+
{{#set: common name=O-acetyl-L-serine}}
+
{{#set: molecular weight=147.13    }}
+
{{#set: common name=O3-acetyl-L-serine|acetylserine|O-acetylserine|(2S)-3-acetyloxy-2-aminopropanoate}}
+
{{#set: consumed by=RXN-12726}}
+
{{#set: produced by=SERINE-O-ACETTRAN-RXN}}
+
{{#set: consumed or produced by=ACSERLY-RXN|SULFOCYS-RXN}}
+

Latest revision as of 16:37, 9 January 2019

Pathway PWY-7220

  • common name:
    • adenosine deoxyribonucleotides de novo biosynthesis II
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

3 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links