Difference between revisions of "CPD-11523"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009499001_1 == * Synonym(s): == Reactions associated == * 1.14.13.78-RXN ** pantograph-a.taliana * RXN-1121 ** pantograph...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11523 CPD-11523] == |
+ | * smiles: | ||
+ | ** CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4) | ||
+ | * molecular weight: | ||
+ | ** 1027.866 | ||
+ | * inchi key: | ||
+ | ** InChIKey=OMDQVIUYDJAWHX-ZMWLRFEFSA-J | ||
+ | * common name: | ||
+ | ** OPC6-3-hydroxyacyl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-10702]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-10704]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[RXN- | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237226 44237226] |
+ | {{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}} | ||
+ | {{#set: molecular weight=1027.866 }} | ||
+ | {{#set: inchi key=InChIKey=OMDQVIUYDJAWHX-ZMWLRFEFSA-J}} | ||
+ | {{#set: common name=OPC6-3-hydroxyacyl-CoA}} | ||
+ | {{#set: consumed by=RXN-10702}} | ||
+ | {{#set: produced by=RXN-10704}} |
Latest revision as of 16:46, 9 January 2019
Contents
Metabolite CPD-11523
- smiles:
- CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
- molecular weight:
- 1027.866
- inchi key:
- InChIKey=OMDQVIUYDJAWHX-ZMWLRFEFSA-J
- common name:
- OPC6-3-hydroxyacyl-CoA
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)" cannot be used as a page name in this wiki.