Difference between revisions of "L-SELENOCYSTEINE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008533001_1 == * Synonym(s): == Reactions associated == * PROTEIN-KINASE-RXN ** pantograph-galdieria.sulphuraria == Pathways asso...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-SELENOCYSTEINE L-SELENOCYSTEINE] == |
+ | * smiles: | ||
+ | ** C([Se])C([N+])C([O-])=O | ||
+ | * molecular weight: | ||
+ | ** 168.054 | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZKZBPNGNEQAJSX-REOHCLBHSA-N | ||
+ | * common name: | ||
+ | ** L-selenocysteine | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** U | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[SELENOCYSTEINE-LYASE-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN-12726]] |
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57843 57843] | ||
+ | * METABOLIGHTS : MTBLC57843 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245418 25245418] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05688 C05688] | ||
+ | * HMDB : HMDB03288 | ||
+ | {{#set: smiles=C([Se])C([N+])C([O-])=O}} | ||
+ | {{#set: molecular weight=168.054 }} | ||
+ | {{#set: inchi key=InChIKey=ZKZBPNGNEQAJSX-REOHCLBHSA-N}} | ||
+ | {{#set: common name=L-selenocysteine}} | ||
+ | {{#set: common name=U}} | ||
+ | {{#set: consumed by=SELENOCYSTEINE-LYASE-RXN}} | ||
+ | {{#set: produced by=RXN-12726}} |
Latest revision as of 16:47, 9 January 2019
Contents
Metabolite L-SELENOCYSTEINE
- smiles:
- C([Se])C([N+])C([O-])=O
- molecular weight:
- 168.054
- inchi key:
- InChIKey=ZKZBPNGNEQAJSX-REOHCLBHSA-N
- common name:
- L-selenocysteine
- Synonym(s):
- U
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([Se])C([N+])C([O-])=O" cannot be used as a page name in this wiki.