Difference between revisions of "RXN-7828"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] == * smiles: ** CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O) * inchi key: ** InChIKey=JT...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7828 RXN-7828] ==
−
* smiles:
+
* direction:
−
** CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=JTFITTQBRJDSTL-KVTDHHQDSA-L
+
** [http://enzyme.expasy.org/EC/2.4.1 EC-2.4.1]
−
* common name:
+
−
** S-methyl-5-thio-α-D-ribose 1-phosphate
+
−
* molecular weight:
+
−
** 258.182   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5-methylthioribose-1-phosphate
 
−
** S5-methyl-5-thio-D-ribose-1-phosphate
 
−
** 5-methylthio-D-ribose-1-phosphate
 
−
** 5-MTR-1-P
 
−
** 1-phosphomethylthioribose
 
−
** 1-phospho-5-S-methylthioribose
 
−
** 1-PMTR
 
−
** 1-phospho-5-S-methylthio-α-D-ribofuranoside
 
−
** S-methyl-5-thio-α-D-ribose 1-phosphate
 
−
** S-methyl-5-thio-D-ribose 1-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[5-METHYLTHIOADENOSINE-PHOSPHORYLASE-RXN]]
+
** 1 [[PELARGONIDIN-3-GLUCOSIDE-CMPD]][c] '''+''' 1 [[CPD-12575]][c] '''=>''' 1 [[UDP]][c] '''+''' 1 [[CPD-7137]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 pelargonidin-3-O-β-D-glucoside[c] '''+''' 1 UDP-α-D-glucose[c] '''=>''' 1 UDP[c] '''+''' 1 pelargonidin-3,5-di-O-β-D-glucoside[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00000989001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Gene: [[CHC_T00001656001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Gene: [[CHC_T00003244001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways  ==
 +
* [[PWY-5139]], pelargonidin conjugates biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5139 PWY-5139]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
* [[PWY-5268]], salvianin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5268 PWY-5268]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* BIGG : 5mdr1p
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: ec number=EC-2.4.1}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266677 45266677]
+
{{#set: gene associated=CHC_T00000989001_1|CHC_T00001656001_1|CHC_T00003244001_1}}
−
* HMDB : HMDB00963
+
{{#set: in pathway=PWY-5139|PWY-5268}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04188 C04188]
+
{{#set: reconstruction source=orthology-arabidopsis_thaliana}}
−
* CHEBI:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58533 58533]
+
−
* METABOLIGHTS : MTBLC58533
+
−
{{#set: smiles=CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O)}}
+
−
{{#set: inchi key=InChIKey=JTFITTQBRJDSTL-KVTDHHQDSA-L}}
+
−
{{#set: common name=S-methyl-5-thio-α-D-ribose 1-phosphate}}
+
−
{{#set: molecular weight=258.182    }}
+
−
{{#set: common name=5-methylthioribose-1-phosphate|S5-methyl-5-thio-D-ribose-1-phosphate|5-methylthio-D-ribose-1-phosphate|5-MTR-1-P|1-phosphomethylthioribose|1-phospho-5-S-methylthioribose|1-PMTR|1-phospho-5-S-methylthio-α-D-ribofuranoside|S-methyl-5-thio-α-D-ribose 1-phosphate|S-methyl-5-thio-D-ribose 1-phosphate}}
+
−
{{#set: produced by=5-METHYLTHIOADENOSINE-PHOSPHORYLASE-RXN}}
+

Latest revision as of 16:44, 9 January 2019

Reaction RXN-7828

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5139, pelargonidin conjugates biosynthesis: PWY-5139
    • 1 reactions found over 6 reactions in the full pathway
  • PWY-5268, salvianin biosynthesis: PWY-5268
    • 1 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-7828&oldid=22192"