Difference between revisions of "PWY-2261"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IDP IDP] == * smiles: ** C(OP(=O)([O-])OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IDP IDP] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2261 PWY-2261] ==
* smiles:
+
** C(OP(=O)([O-])OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))
+
* inchi key:
+
** InChIKey=JPXZQMKKFWMMGK-KQYNXXCUSA-K
+
 
* common name:
 
* common name:
** IDP
+
** ascorbate glutathione cycle
* molecular weight:
+
* taxonomic range:
** 425.165   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-33682]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
 
* Synonym(s):
 
* Synonym(s):
** riboxin
+
** hydrogen peroxide detoxification
** inosine diphosphate
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-14003]]
+
'''2''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[1.8.5.1-RXN]]
* [[RXN0-5073]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00005252001_1]]
* [[RXN-14120]]
+
** 1 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-3521]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00010024001]]
 +
*** [[CHC_T00008640001]]
 +
*** [[CHC_T00010024001_1]]
 +
*** [[CHC_T00008640001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-3522 RXN-3522]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-3523 RXN-3523]
 
== External links  ==
 
== External links  ==
* CAS : 86-04-4
+
* ARACYC:
* METABOLIGHTS : MTBLC58280
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-2261 PWY-2261]
* PUBCHEM:
+
{{#set: common name=ascorbate glutathione cycle}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7156952 7156952]
+
{{#set: taxonomic range=TAX-33682}}
* HMDB : HMDB03335
+
{{#set: taxonomic range=TAX-33090}}
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-1117}}
** [http://www.genome.jp/dbget-bin/www_bget?C00104 C00104]
+
{{#set: common name=hydrogen peroxide detoxification}}
* CHEMSPIDER:
+
{{#set: reaction found=2}}
** [http://www.chemspider.com/Chemical-Structure.3279691.html 3279691]
+
{{#set: total reaction=4}}
* CHEBI:
+
{{#set: completion rate=50.0}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58280 58280]
+
* BIGG : idp
+
{{#set: smiles=C(OP(=O)([O-])OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
+
{{#set: inchi key=InChIKey=JPXZQMKKFWMMGK-KQYNXXCUSA-K}}
+
{{#set: common name=IDP}}
+
{{#set: molecular weight=425.165    }}
+
{{#set: common name=riboxin|inosine diphosphate}}
+
{{#set: consumed by=RXN-14003}}
+
{{#set: produced by=RXN0-5073}}
+
{{#set: consumed or produced by=RXN-14120}}
+

Latest revision as of 16:39, 9 January 2019

Pathway PWY-2261

  • common name:
    • ascorbate glutathione cycle
  • taxonomic range:
  • Synonym(s):
    • hydrogen peroxide detoxification

Reaction(s) found

2 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links