Difference between revisions of "CMP-KDO"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-561 PWY-561] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-561 PWY-561] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CMP-KDO CMP-KDO] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** C(O)C(O)[CH]3(OC(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))([O-])=O)(C([O-])=O)CC(C3O)O)
 +
* molecular weight:
 +
** 541.361   
 +
* inchi key:
 +
** InChIKey=YWWJKULNWGRYAS-XKKDATLGSA-L
 
* common name:
 
* common name:
−
** superpathway of glyoxylate cycle and fatty acid degradation
+
** CMP-3-deoxy-β-D-manno-octulosonate
 
* Synonym(s):
 
* Synonym(s):
 +
** CMP-2-dehydro-3-deoxy-D-octonate
 +
** CMP-Kdo
 +
** CMP-β-Kdo
 +
** CMP-ketodeoxyoctonate
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
* '''5''' reaction(s) found
+
* [[KDOTRANS-RXN]]
−
** [[PWY-5136]]
+
* [[KDOTRANS2-RXN]]
−
** [[MALATE-DEH-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** [[GLYOXYLATE-BYPASS]]
+
== Reaction(s) of unknown directionality ==
−
** [[RXN-14971]]
+
−
** [[FUMHYDR-RXN]]
+
−
== Reaction(s) not found ==
+
−
* '''1''' reaction(s) not found
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=PEPCARBOXYKIN-RXN PEPCARBOXYKIN-RXN]
+
 
== External links  ==
 
== External links  ==
−
* METACYC:
+
* CHEBI:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=PWY-561 PWY-561]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85987 85987]
−
{{#set: taxonomic range=TAX-33090}}
+
* BIGG : ckdo
−
{{#set: common name=superpathway of glyoxylate cycle and fatty acid degradation}}
+
* PUBCHEM:
−
{{#set: reaction found=5}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91825729 91825729]
−
{{#set: reaction not found=1}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C04121 C04121]
 +
{{#set: smiles=C(O)C(O)[CH]3(OC(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))([O-])=O)(C([O-])=O)CC(C3O)O)}}
 +
{{#set: molecular weight=541.361    }}
 +
{{#set: inchi key=InChIKey=YWWJKULNWGRYAS-XKKDATLGSA-L}}
 +
{{#set: common name=CMP-3-deoxy-β-D-manno-octulosonate}}
 +
{{#set: common name=CMP-2-dehydro-3-deoxy-D-octonate|CMP-Kdo|CMP-β-Kdo|CMP-ketodeoxyoctonate}}
 +
{{#set: consumed by=KDOTRANS-RXN|KDOTRANS2-RXN}}

Latest revision as of 16:48, 9 January 2019

Metabolite CMP-KDO

  • smiles:
    • C(O)C(O)[CH]3(OC(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))([O-])=O)(C([O-])=O)CC(C3O)O)
  • molecular weight:
    • 541.361
  • inchi key:
    • InChIKey=YWWJKULNWGRYAS-XKKDATLGSA-L
  • common name:
    • CMP-3-deoxy-β-D-manno-octulosonate
  • Synonym(s):
    • CMP-2-dehydro-3-deoxy-D-octonate
    • CMP-Kdo
    • CMP-β-Kdo
    • CMP-ketodeoxyoctonate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(O)[CH]3(OC(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))([O-])=O)(C([O-])=O)CC(C3O)O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CMP-KDO&oldid=22298"