Difference between revisions of "CHC T00009450001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] == * smiles: ** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-]) * inchi key: ** InChIKey=Z...")
 
(Created page with "Category:Gene == Gene CHC_T00009450001 == * left end position: ** 110048 * transcription direction: ** NEGATIVE * right end position: ** 111394 * centisome position: ** 73...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] ==
+
== Gene CHC_T00009450001 ==
−
* smiles:
+
* left end position:
−
** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])
+
** 110048
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 9-mercaptodethiobiotin
+
** 111394
−
* molecular weight:
+
* centisome position:
−
** 245.316    
+
** 73.381966    
 
* Synonym(s):
 
* Synonym(s):
−
** 9-mercaptodesthiobiotin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17473]]
+
* Reaction: [[LYSOPHOSPHOLIPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-original_genome]]
−
* [[RXN-17472]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-15035]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7409]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=110048}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244092 25244092]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])}}
+
{{#set: right end position=111394}}
−
{{#set: inchi key=InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M}}
+
{{#set: centisome position=73.381966   }}
−
{{#set: common name=9-mercaptodethiobiotin}}
+
{{#set: reaction associated=LYSOPHOSPHOLIPASE-RXN|RXN-15035}}
−
{{#set: molecular weight=245.316   }}
+
{{#set: pathway associated=PWY-7409}}
−
{{#set: common name=9-mercaptodesthiobiotin}}
+
−
{{#set: consumed by=RXN-17473}}
+
−
{{#set: produced by=RXN-17472}}
+

Latest revision as of 16:04, 23 May 2018

Gene CHC_T00009450001

  • left end position:
    • 110048
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 111394
  • centisome position:
    • 73.381966
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00009450001&oldid=16081"