Difference between revisions of "1.1.1.34-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUMP DUMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: **...") |
|||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.34-RXN 1.1.1.34-RXN] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.34 EC-1.1.1.34] |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 2 [[NADP]][c] '''+''' 1 [[MEVALONATE]][c] '''+''' 1 [[CO-A]][c] '''<=>''' 2 [[PROTON]][c] '''+''' 2 [[NADPH]][c] '''+''' 1 [[3-HYDROXY-3-METHYL-GLUTARYL-COA]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 2 NADP+[c] '''+''' 1 (R)-mevalonate[c] '''+''' 1 coenzyme A[c] '''<=>''' 2 H+[c] '''+''' 2 NADPH[c] '''+''' 1 (S)-3-hydroxy-3-methylglutaryl-CoA[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | == | + | Genes have been associated with this reaction based on different elements listed below. |
+ | * Gene: [[CHC_T00006657001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6174]], mevalonate pathway II (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6174 PWY-6174] | ||
+ | ** '''7''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-7524]], mevalonate pathway III (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7524 PWY-7524] | ||
+ | ** '''5''' reactions found over '''8''' reactions in the full pathway | ||
+ | * [[PWY-922]], mevalonate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-922 PWY-922] | ||
+ | ** '''7''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-7391]], isoprene biosynthesis II (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7391 PWY-7391] | ||
+ | ** '''7''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15989 15989] |
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P16393 P16393] |
− | * | + | ** [http://www.uniprot.org/uniprot/P14891 P14891] |
− | * | + | ** [http://www.uniprot.org/uniprot/P16237 P16237] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P20715 P20715] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q59468 Q59468] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q01237 Q01237] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q61671 Q61671] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q944T9 Q944T9] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9S9C2 Q9S9C2] |
− | + | ** [http://www.uniprot.org/uniprot/Q9S999 Q9S999] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9S998 Q9S998] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9S997 Q9S997] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P04035 P04035] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P00347 P00347] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P29058 P29058] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P29057 P29057] |
+ | ** [http://www.uniprot.org/uniprot/Q12577 Q12577] | ||
+ | ** [http://www.uniprot.org/uniprot/Q12649 Q12649] | ||
+ | ** [http://www.uniprot.org/uniprot/Q00583 Q00583] | ||
+ | ** [http://www.uniprot.org/uniprot/Q01559 Q01559] | ||
+ | ** [http://www.uniprot.org/uniprot/P48022 P48022] | ||
+ | ** [http://www.uniprot.org/uniprot/Q43825 Q43825] | ||
+ | ** [http://www.uniprot.org/uniprot/Q43826 Q43826] | ||
+ | ** [http://www.uniprot.org/uniprot/P14773 P14773] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7M4W2 Q7M4W2] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7M4W1 Q7M4W1] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7M4W4 Q7M4W4] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7M4W3 Q7M4W3] | ||
+ | ** [http://www.uniprot.org/uniprot/P48019 P48019] | ||
+ | ** [http://www.uniprot.org/uniprot/Q41454 Q41454] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42506 Q42506] | ||
+ | ** [http://www.uniprot.org/uniprot/Q41455 Q41455] | ||
+ | ** [http://www.uniprot.org/uniprot/Q41456 Q41456] | ||
+ | ** [http://www.uniprot.org/uniprot/Q41458 Q41458] | ||
+ | ** [http://www.uniprot.org/uniprot/P48020 P48020] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9FS01 Q9FS01] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42466 Q42466] | ||
+ | ** [http://www.uniprot.org/uniprot/O48624 O48624] | ||
+ | ** [http://www.uniprot.org/uniprot/O04188 O04188] | ||
+ | ** [http://www.uniprot.org/uniprot/O24594 O24594] | ||
+ | ** [http://www.uniprot.org/uniprot/Q41438 Q41438] | ||
+ | ** [http://www.uniprot.org/uniprot/O64966 O64966] | ||
+ | ** [http://www.uniprot.org/uniprot/O64967 O64967] | ||
+ | ** [http://www.uniprot.org/uniprot/Q03163 Q03163] | ||
+ | ** [http://www.uniprot.org/uniprot/Q39628 Q39628] | ||
+ | ** [http://www.uniprot.org/uniprot/P93514 P93514] | ||
+ | ** [http://www.uniprot.org/uniprot/O08424 O08424] | ||
+ | * LIGAND-RXN: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?R02082 R02082] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: ec number=EC-1.1.1.34}} | ||
+ | {{#set: gene associated=CHC_T00006657001_1}} | ||
+ | {{#set: in pathway=PWY-6174|PWY-7524|PWY-922|PWY-7391}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction source=orthology-ectocarpus_siliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 16:46, 9 January 2019
Contents
Reaction 1.1.1.34-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 2 NADP[c] + 1 MEVALONATE[c] + 1 CO-A[c] <=> 2 PROTON[c] + 2 NADPH[c] + 1 3-HYDROXY-3-METHYL-GLUTARYL-COA[c]
- With common name(s):
- 2 NADP+[c] + 1 (R)-mevalonate[c] + 1 coenzyme A[c] <=> 2 H+[c] + 2 NADPH[c] + 1 (S)-3-hydroxy-3-methylglutaryl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00006657001_1
- Source: orthology-ectocarpus_siliculosus
Pathways
- PWY-6174, mevalonate pathway II (archaea): PWY-6174
- 7 reactions found over 7 reactions in the full pathway
- PWY-7524, mevalonate pathway III (archaea): PWY-7524
- 5 reactions found over 8 reactions in the full pathway
- PWY-922, mevalonate pathway I: PWY-922
- 7 reactions found over 7 reactions in the full pathway
- PWY-7391, isoprene biosynthesis II (engineered): PWY-7391
- 7 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
External links
- RHEA:
- UNIPROT:
- P16393
- P14891
- P16237
- P20715
- Q59468
- Q01237
- Q61671
- Q944T9
- Q9S9C2
- Q9S999
- Q9S998
- Q9S997
- P04035
- P00347
- P29058
- P29057
- Q12577
- Q12649
- Q00583
- Q01559
- P48022
- Q43825
- Q43826
- P14773
- Q7M4W2
- Q7M4W1
- Q7M4W4
- Q7M4W3
- P48019
- Q41454
- Q42506
- Q41455
- Q41456
- Q41458
- P48020
- Q9FS01
- Q42466
- O48624
- O04188
- O24594
- Q41438
- O64966
- O64967
- Q03163
- Q39628
- P93514
- O08424
- LIGAND-RXN: