Difference between revisions of "PWY-7303"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYCYTIDINE DEOXYCYTIDINE] == * smiles: ** C1(=CN(C(=O)N=C(N)1)C2(CC(O)C(CO)O2)) * inchi key:...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7303 PWY-7303] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-dimethylallyl-4-hydroxybenzoate biosynthesis |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2062 TAX-2062] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''4''' reactions in the full pathway |
| − | + | * [[PREPHENATEDEHYDROG-RXN]] | |
| − | * [[ | + | ** 0 associated gene: |
| − | == Reaction(s) | + | ** 1 reconstruction source(s) associated: |
| + | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14631 RXN-14631] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14670 RXN-14670] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14671 RXN-14671] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=3-dimethylallyl-4-hydroxybenzoate biosynthesis}} | |
| − | + | {{#set: taxonomic range=TAX-2062}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=25.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 16:41, 9 January 2019
Pathway PWY-7303
- common name:
- 3-dimethylallyl-4-hydroxybenzoate biosynthesis
- taxonomic range:
- Synonym(s):
Reaction(s) found
1 reactions found over 4 reactions in the full pathway
- PREPHENATEDEHYDROG-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
