Difference between revisions of "PANTO-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9852 CPD-9852] == * smiles: ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9852 CPD-9852] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PANTO-PWY PANTO-PWY] ==
* smiles:
+
** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C
+
* inchi key:
+
** InChIKey=PEMFGDIFKKXFRG-PYHSYOTJSA-M
+
 
* common name:
 
* common name:
** 3-heptaprenyl-4-hydroxybenzoate
+
** phosphopantothenate biosynthesis I
* molecular weight:
+
* taxonomic range:
** 613.942   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
 +
** vitamin B5 biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''4''' reactions in the full pathway
* [[RXN-9222]]
+
* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[CHC_T00002917001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00001868001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00001099001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[PANTOTHENATE-KIN-RXN]]
 +
** 3 associated gene(s):
 +
*** [[CHC_T00002958001_1]]
 +
*** [[CHC_T00006632001_1]]
 +
*** [[CHC_T00002103001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740346 54740346]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PANTO-PWY PANTO-PWY]
* CHEBI:
+
{{#set: common name=phosphopantothenate biosynthesis I}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84496 84496]
+
{{#set: taxonomic range=TAX-4751}}
{{#set: smiles=CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C}}
+
{{#set: taxonomic range=TAX-33090}}
{{#set: inchi key=InChIKey=PEMFGDIFKKXFRG-PYHSYOTJSA-M}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: common name=3-heptaprenyl-4-hydroxybenzoate}}
+
{{#set: common name=vitamin B5 biosynthesis}}
{{#set: molecular weight=613.942    }}
+
{{#set: reaction found=4}}
{{#set: produced by=RXN-9222}}
+
{{#set: total reaction=4}}
 +
{{#set: completion rate=100.0}}

Latest revision as of 16:42, 9 January 2019

Pathway PANTO-PWY

  • common name:
    • phosphopantothenate biosynthesis I
  • taxonomic range:
  • Synonym(s):
    • vitamin B5 biosynthesis

Reaction(s) found

4 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links