Difference between revisions of "Red-NADPH-Hemoprotein-Reductases"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL-PYRUVATE PHENYL-PYRUVATE] == * smiles: ** C([O-])(=O)C(=O)CC1(=CC=CC=C1) * inchi key: **...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-NADPH-Hemoprotein-Reductases Red-NADPH-Hemoprotein-Reductases] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a reduced [NADPH-hemoprotein reductase] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[HEME-OXYGENASE-DECYCLIZING-RXN]] |
− | * [[RXN- | + | * [[RXN-11056]] |
+ | * [[RXN-11057]] | ||
+ | * [[RXN-17625]] | ||
+ | * [[SQUALENE-MONOOXYGENASE-RXN]] | ||
+ | * [[RXN66-163]] | ||
+ | * [[RXN66-181]] | ||
+ | * [[RXN66-169]] | ||
+ | * [[RXN-4243]] | ||
+ | * [[RXN-8872]] | ||
+ | * [[RXN-8630]] | ||
+ | * [[UNSPECIFIC-MONOOXYGENASE-RXN]] | ||
+ | * [[RXN-17627]] | ||
+ | * [[RXN-13064]] | ||
+ | * [[RXN66-146]] | ||
+ | * [[RXN66-161]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=a reduced [NADPH-hemoprotein reductase]}} | |
− | + | {{#set: consumed by=HEME-OXYGENASE-DECYCLIZING-RXN|RXN-11056|RXN-11057|RXN-17625|SQUALENE-MONOOXYGENASE-RXN|RXN66-163|RXN66-181|RXN66-169|RXN-4243|RXN-8872|RXN-8630|UNSPECIFIC-MONOOXYGENASE-RXN|RXN-17627|RXN-13064|RXN66-146|RXN66-161}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 17:51, 9 January 2019
Contents
Metabolite Red-NADPH-Hemoprotein-Reductases
- common name:
- a reduced [NADPH-hemoprotein reductase]
- Synonym(s):
Reaction(s) known to consume the compound
- HEME-OXYGENASE-DECYCLIZING-RXN
- RXN-11056
- RXN-11057
- RXN-17625
- SQUALENE-MONOOXYGENASE-RXN
- RXN66-163
- RXN66-181
- RXN66-169
- RXN-4243
- RXN-8872
- RXN-8630
- UNSPECIFIC-MONOOXYGENASE-RXN
- RXN-17627
- RXN-13064
- RXN66-146
- RXN66-161
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a reduced [NADPH-hemoprotein reductase" cannot be used as a page name in this wiki.