Difference between revisions of "CPD0-1699"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SULFITE-REDUCT-RXN SULFITE-REDUCT-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enz...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=SULFITE-REDUCT-RXN SULFITE-REDUCT-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1699 CPD0-1699] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2))
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.8.1.2 EC-1.8.1.2]
+
** 210.172   
 +
* inchi key:
 +
** InChIKey=QSIYONWVWDSRRO-UHFFFAOYSA-M
 +
* common name:
 +
** 6-carboxy-5,6,7,8-tetrahydropterin
 
* Synonym(s):
 
* Synonym(s):
 +
** 6-carboxytetrahydropterin
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 5 [[PROTON]][c] '''+''' 3 [[NADPH]][c] '''+''' 1 [[SO3]][c] '''=>''' 3 [[WATER]][c] '''+''' 3 [[NADP]][c] '''+''' 1 [[HS]][c]
+
* [[RXN0-5507]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 5 H+[c] '''+''' 3 NADPH[c] '''+''' 1 sulfite[c] '''=>''' 3 H2O[c] '''+''' 3 NADP+[c] '''+''' 1 hydrogen sulfide[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008333001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[SO4ASSIM-PWY]], sulfate reduction I (assimilatory): [http://metacyc.org/META/NEW-IMAGE?object=SO4ASSIM-PWY SO4ASSIM-PWY]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-6683]], sulfate reduction III (assimilatory): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6683 PWY-6683]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CHEBI:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13801 13801]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61032 61032]
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00858 R00858]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123380 44123380]
−
* UNIPROT:
+
{{#set: smiles=C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2))}}
−
** [http://www.uniprot.org/uniprot/P38039 P38039]
+
{{#set: molecular weight=210.172    }}
−
** [http://www.uniprot.org/uniprot/P17845 P17845]
+
{{#set: inchi key=InChIKey=QSIYONWVWDSRRO-UHFFFAOYSA-M}}
−
** [http://www.uniprot.org/uniprot/Q9JUD9 Q9JUD9]
+
{{#set: common name=6-carboxy-5,6,7,8-tetrahydropterin}}
−
** [http://www.uniprot.org/uniprot/Q9JUD8 Q9JUD8]
+
{{#set: common name=6-carboxytetrahydropterin}}
−
** [http://www.uniprot.org/uniprot/O32214 O32214]
+
{{#set: produced by=RXN0-5507}}
−
** [http://www.uniprot.org/uniprot/P38038 P38038]
+
−
** [http://www.uniprot.org/uniprot/Q59396 Q59396]
+
−
** [http://www.uniprot.org/uniprot/P17846 P17846]
+
−
** [http://www.uniprot.org/uniprot/P52674 P52674]
+
−
** [http://www.uniprot.org/uniprot/P39692 P39692]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: ec number=EC-1.8.1.2}}
+
−
{{#set: gene associated=CHC_T00008333001_1}}
+
−
{{#set: in pathway=SO4ASSIM-PWY|PWY-6683}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+

Latest revision as of 16:52, 9 January 2019

Metabolite CPD0-1699

  • smiles:
    • C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2))
  • molecular weight:
    • 210.172
  • inchi key:
    • InChIKey=QSIYONWVWDSRRO-UHFFFAOYSA-M
  • common name:
    • 6-carboxy-5,6,7,8-tetrahydropterin
  • Synonym(s):
    • 6-carboxytetrahydropterin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(NC2(N=C(N)NC(=O)C(NC1C(=O)[O-])=2))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD0-1699&oldid=22385"