Difference between revisions of "PWY-5152"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-294 CPD-294] == * smiles: ** C(=CC(=O)[O-])C(=O)CC([O-])=O * inchi key: ** InChIKey=SOXXPQL...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5152 PWY-5152] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** leucodelphinidin biosynthesis |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-58024] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''5''' reactions in the full pathway | |
| − | * [[RXN- | + | * [[RXN-7784]] |
| − | * [[ | + | ** 1 associated gene(s): |
| − | == Reaction(s) | + | *** [[CHC_T00009538001_1]] |
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13718 RXN-13718] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-525 RXN-525] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7921 RXN-7921] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7922 RXN-7922] | ||
== External links == | == External links == | ||
| − | * | + | * ARACYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5152 PWY-5152] |
| − | + | {{#set: common name=leucodelphinidin biosynthesis}} | |
| − | + | {{#set: taxonomic range=TAX-58024}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=5}} | |
| − | + | {{#set: completion rate=20.0}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 16:44, 9 January 2019
Pathway PWY-5152
- common name:
- leucodelphinidin biosynthesis
- taxonomic range:
- Synonym(s):
Reaction(s) found
1 reactions found over 5 reactions in the full pathway
- RXN-7784
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC:
