Difference between revisions of "CPD-294"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.8.1.6-RXN 2.8.1.6-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** biotin synthetase * ec...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-294 CPD-294] == |
− | * | + | * smiles: |
− | ** | + | ** C(=CC(=O)[O-])C(=O)CC([O-])=O |
+ | * molecular weight: | ||
+ | ** 156.095 | ||
+ | * inchi key: | ||
+ | ** InChIKey=SOXXPQLIZIPMIZ-UPHRSURJSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** 2-maleylacetate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 4-oxohex-2-enedioate | ||
+ | ** maleylacetate | ||
+ | ** (2Z)-4-oxohex-2-enedioate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-9868]] | |
− | + | * [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CHEBI: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16468 16468] |
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543165 9543165] |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02222 C02222] | |
− | + | * UM-BBD-CPD : c0099 | |
− | * | + | * CHEMSPIDER: |
− | ** [http://www. | + | ** [http://www.chemspider.com/Chemical-Structure.7822138.html 7822138] |
− | * | + | {{#set: smiles=C(=CC(=O)[O-])C(=O)CC([O-])=O}} |
− | * | + | {{#set: molecular weight=156.095 }} |
− | ** [http://www. | + | {{#set: inchi key=InChIKey=SOXXPQLIZIPMIZ-UPHRSURJSA-L}} |
− | + | {{#set: common name=2-maleylacetate}} | |
− | + | {{#set: common name=4-oxohex-2-enedioate|maleylacetate|(2Z)-4-oxohex-2-enedioate}} | |
− | + | {{#set: produced by=RXN-9868|CARBOXYMETHYLENEBUTENOLIDASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 16:54, 9 January 2019
Contents
Metabolite CPD-294
- smiles:
- C(=CC(=O)[O-])C(=O)CC([O-])=O
- molecular weight:
- 156.095
- inchi key:
- InChIKey=SOXXPQLIZIPMIZ-UPHRSURJSA-L
- common name:
- 2-maleylacetate
- Synonym(s):
- 4-oxohex-2-enedioate
- maleylacetate
- (2Z)-4-oxohex-2-enedioate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=CC(=O)[O-])C(=O)CC([O-])=O" cannot be used as a page name in this wiki.