Difference between revisions of "RXN-17895"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-7-DIMETHYLXANTHINE 3-7-DIMETHYLXANTHINE] == * smiles: ** CN2(C=NC1(=C(C(NC(N(C)1)=O)=O)2)) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17895 RXN-17895] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17895 RXN-17895] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1 [[CPD-18773]][c] '''<=>''' 1 [[CPD-19220]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 (R)-demethyl-4-deoxygadusol[c] '''<=>''' 1 (S)-demethyl-4-deoxygadusol[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | * [[PWY-7751]], shinorine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7751 PWY-7751] | ||
| + | ** '''6''' reactions found over '''8''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[gap-filling]] | ||
| + | ** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
| + | *** Tool: [[meneco]] | ||
| + | **** Comment: [[added for gapfilling]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: in pathway=PWY-7751}} | |
| − | + | {{#set: reconstruction category=gap-filling}} | |
| − | + | {{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}} | |
| − | + | {{#set: reconstruction tool=meneco}} | |
| − | + | {{#set: reconstruction comment=added for gapfilling}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 16:08, 23 May 2018
Contents
Reaction RXN-17895
- direction:
- REVERSIBLE
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 (R)-demethyl-4-deoxygadusol[c] <=> 1 (S)-demethyl-4-deoxygadusol[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: gap-filling
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
- Tool: meneco
- Comment: added for gapfilling
- Tool: meneco
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
